EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C22H15N3O4 |
| Net Charge | 0 |
| Average Mass | 385.379 |
| Monoisotopic Mass | 385.10626 |
| SMILES | O=C(O)c1nc(C(=O)O)c(-c2cnc3ccccc23)c1-c1cnc2ccccc12 |
| InChI | InChI=1S/C22H15N3O4/c26-21(27)19-17(13-9-23-15-7-3-1-5-11(13)15)18(20(25-19)22(28)29)14-10-24-16-8-4-2-6-12(14)16/h1-10,23-25H,(H,26,27)(H,28,29) |
| InChIKey | FZDVNXHYGMEEDT-UHFFFAOYSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Chromobacterium violaceum (ncbitaxon:536) | - | PubMed (20490411) | |
| Streptomyces albus (ncbitaxon:1888) | - | PubMed (19246195) |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| Biological Role: | bacterial metabolite Any prokaryotic metabolite produced during a metabolic reaction in bacteria. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| chromopyrrolic acid (CHEBI:41625) has role bacterial metabolite (CHEBI:76969) |
| chromopyrrolic acid (CHEBI:41625) is a indoles (CHEBI:24828) |
| chromopyrrolic acid (CHEBI:41625) is a pyrroledicarboxylic acid (CHEBI:59197) |
| chromopyrrolic acid (CHEBI:41625) is conjugate acid of chromopyrrolate(2−) (CHEBI:133898) |
| Incoming Relation(s) |
| chromopyrrolate(2−) (CHEBI:133898) is conjugate base of chromopyrrolic acid (CHEBI:41625) |
| IUPAC Name |
|---|
| 3,4-di(1H-indol-3-yl)-1H-pyrrole-2,5-dicarboxylic acid |
| Synonym | Source |
|---|---|
| 3,4-di(indol-3-yl)pyrrole-2,5-dicarboxylic acid | ChEBI |
| Citations |
|---|