EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
CHEBI:41550 - fluoroform
| Formula | CHF3 |
| Net Charge | 0 |
| Average Mass | 70.013 |
| Monoisotopic Mass | 70.00303 |
| SMILES | [H]C(F)(F)F |
| InChI | InChI=1S/CHF3/c2-1(3)4/h1H |
| InChIKey | XPDWGBQVDMORPB-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Application: | refrigerant A substance used in a thermodynamic heat pump cycle or refrigeration cycle that undergoes a phase change from a gas to a liquid and back. Refrigerants are used in air-conditioning systems and freezers or refrigerators and are assigned a "R" number (by ASHRAE - formerly the American Society of Heating, Refrigerating and Air Conditioning Engineers), which is determined systematically according to their molecular structure. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| fluoroform (CHEBI:41550) has role refrigerant (CHEBI:78433) |
| fluoroform (CHEBI:41550) is a fluoromethanes (CHEBI:39281) |
| Incoming Relation(s) |
| (trifluoromethyl)benzene (CHEBI:36810) has functional parent fluoroform (CHEBI:41550) |
| trifluoromethyl group (CHEBI:50127) is substituent group from fluoroform (CHEBI:41550) |
| IUPAC Name |
|---|
| fluoroform |
| Synonyms | Source |
|---|---|
| carbon trifluoride | UM-BBD |
| CHF3 | IUPAC |
| Freon 23 | ChemIDplus |
| Freon F-23 | NIST Chemistry WebBook |
| methyl trifluoride | NIST Chemistry WebBook |
| TRIFLUOROMETHANE | PDBeChem |