EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C11H14N4O2 |
| Net Charge | 0 |
| Average Mass | 234.259 |
| Monoisotopic Mass | 234.11168 |
| SMILES | [H][C@@]12CCCN1C(=O)[C@H](Cc1cncn1)NC2=O |
| InChI | InChI=1S/C11H14N4O2/c16-10-9-2-1-3-15(9)11(17)8(14-10)4-7-5-12-6-13-7/h5-6,8-9H,1-4H2,(H,12,13)(H,14,16)/t8-,9-/m0/s1 |
| InChIKey | NAKUGCPAQTUSBE-IUCAKERBSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Homo sapiens (ncbitaxon:9606) | |||
| blood serum (BTO:0000133) | PubMed (6401750) | ||
| brain (BTO:0000142) | PubMed (6672793) |
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| Biological Roles: | dopamine uptake inhibitor A dopaminergic agent that blocks the transport of dopamine into axon terminals or into storage vesicles within terminals. Most of the adrenergic uptake inhibitors also inhibit dopamine uptake. human blood serum metabolite Any metabolite (endogenous or exogenous) found in human blood serum samples. |
| Applications: | dopamine uptake inhibitor A dopaminergic agent that blocks the transport of dopamine into axon terminals or into storage vesicles within terminals. Most of the adrenergic uptake inhibitors also inhibit dopamine uptake. anti-inflammatory agent Any compound that has anti-inflammatory effects. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| cyclo(L-His-L-Pro) (CHEBI:90039) has functional parent L-histidine (CHEBI:15971) |
| cyclo(L-His-L-Pro) (CHEBI:90039) has functional parent L-proline (CHEBI:17203) |
| cyclo(L-His-L-Pro) (CHEBI:90039) has role anti-inflammatory agent (CHEBI:67079) |
| cyclo(L-His-L-Pro) (CHEBI:90039) has role dopamine uptake inhibitor (CHEBI:51039) |
| cyclo(L-His-L-Pro) (CHEBI:90039) has role human blood serum metabolite (CHEBI:85234) |
| cyclo(L-His-L-Pro) (CHEBI:90039) is a dipeptide (CHEBI:46761) |
| cyclo(L-His-L-Pro) (CHEBI:90039) is a homodetic cyclic peptide (CHEBI:24613) |
| cyclo(L-His-L-Pro) (CHEBI:90039) is a imidazoles (CHEBI:24780) |
| cyclo(L-His-L-Pro) (CHEBI:90039) is a pyrrolopyrazine (CHEBI:48337) |
| IUPAC Name |
|---|
| (3S,8aS)-3-[(1H-imidazol-5-yl)methyl]hexahydropyrrolo[1,2-a]pyrazine-1,4-dione |
| Synonyms | Source |
|---|---|
| cyclo(His-Pro) | ChemIDplus |
| cyclo(histidyl-prolyl) | ChEBI |
| cyclo(L-His-L-Pro) | ChEBI |
| His-Pro-DKP | ChEBI |
| histidyl-proline diketopiperazine | ChEBI |
| histidyl-proline-diketopiperazine | ChEBI |
| UniProt Name | Source |
|---|---|
| L-histidyl-L-proline diketopiperazine | UniProt |
| Manual Xrefs | Databases |
|---|---|
| CHQ | PDBeChem |
| FDB022818 | FooDB |
| HMDB0002053 | HMDB |
| Registry Numbers | Sources |
|---|---|
| CAS:53109-32-3 | ChemIDplus |
| Citations |
|---|