EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C14H12O2 |
| Net Charge | 0 |
| Average Mass | 212.248 |
| Monoisotopic Mass | 212.08373 |
| SMILES | O=C(OCc1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C14H12O2/c15-14(13-9-5-2-6-10-13)16-11-12-7-3-1-4-8-12/h1-10H,11H2 |
| InChIKey | SESFRYSPDFLNCH-UHFFFAOYSA-N |
| Wikipedia |
|---|
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Polyalthia (ncbitaxon:105756) | - | PubMed (24520907) |
| Roles Classification |
|---|
| Biological Role: | plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. |
| Applications: | scabicide An acaricide that kills mites of the genus Sarcoptes. acaricide A substance used to destroy pests of the subclass Acari (mites and ticks). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| benzyl benzoate (CHEBI:41237) has functional parent benzoic acid (CHEBI:30746) |
| benzyl benzoate (CHEBI:41237) has role acaricide (CHEBI:22153) |
| benzyl benzoate (CHEBI:41237) has role plant metabolite (CHEBI:76924) |
| benzyl benzoate (CHEBI:41237) has role scabicide (CHEBI:73333) |
| benzyl benzoate (CHEBI:41237) is a benzoate ester (CHEBI:36054) |
| benzyl benzoate (CHEBI:41237) is a benzyl ester (CHEBI:90628) |
| IUPAC Name |
|---|
| benzyl benzoate |
| Synonyms | Source |
|---|---|
| Benylate | ChemIDplus |
| benzoic acid, benzyl ester | NIST Chemistry WebBook |
| benzoic acid, phenylmethyl ester | ChemIDplus |
| BENZOIC ACID PHENYLMETHYLESTER | PDBeChem |
| phenylmethyl benzoate | ChemIDplus |
| UniProt Name | Source |
|---|---|
| benzyl benzoate | UniProt |
| Manual Xrefs | Databases |
|---|---|
| 1473 | VSDB |
| 1473 | PPDB |
| 335 | DrugCentral |
| Benzyl_Benzoate | Wikipedia |
| BZM | PDBeChem |
| CPD-6443 | MetaCyc |
| D01138 | KEGG DRUG |
| DB00676 | DrugBank |
| HMDB0014814 | HMDB |
| Citations |
|---|