EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C14H14N2O3S |
| Net Charge | 0 |
| Average Mass | 290.344 |
| Monoisotopic Mass | 290.07251 |
| SMILES | NS(=O)(=O)c1ccc(C(=O)NCc2ccccc2)cc1 |
| InChI | InChI=1S/C14H14N2O3S/c15-20(18,19)13-8-6-12(7-9-13)14(17)16-10-11-4-2-1-3-5-11/h1-9H,10H2,(H,16,17)(H2,15,18,19) |
| InChIKey | CZKNSZUJCJHTTM-UHFFFAOYSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Colletotrichum sublineola (ncbitaxon:1173701) | - | PubMed (30824820) | Species also known as Colletotrichum sublineolum. |
| Roles Classification |
|---|
| Biological Roles: | EC 4.2.1.1 (carbonic anhydrase) inhibitor An EC 4.2.1.* (hydro-lyases) inhibitor that interferes with the action of carbonic anhydrase (EC 4.2.1.1). Such compounds reduce the secretion of H+ ions by the proximal kidney tubule. fungal metabolite Any eukaryotic metabolite produced during a metabolic reaction in fungi, the kingdom that includes microorganisms such as the yeasts and moulds. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| N-benzyl-4-sulfamoylbenzamide (CHEBI:41231) has role EC 4.2.1.1 (carbonic anhydrase) inhibitor (CHEBI:23018) |
| N-benzyl-4-sulfamoylbenzamide (CHEBI:41231) has role fungal metabolite (CHEBI:76946) |
| N-benzyl-4-sulfamoylbenzamide (CHEBI:41231) is a benzamides (CHEBI:22702) |
| N-benzyl-4-sulfamoylbenzamide (CHEBI:41231) is a benzenes (CHEBI:22712) |
| N-benzyl-4-sulfamoylbenzamide (CHEBI:41231) is a secondary carboxamide (CHEBI:140325) |
| N-benzyl-4-sulfamoylbenzamide (CHEBI:41231) is a sulfonamide (CHEBI:35358) |
| IUPAC Name |
|---|
| N-benzyl-4-sulfamoylbenzamide |
| Synonyms | Source |
|---|---|
| 4-(aminosulfonyl)-N-benzylbenzamide | ChEBI |
| 4-(benzylcarbamoyl)benzenesulfonamide | ChEBI |
| N-benzyl-4-(aminosulfonyl)benzamide | ChEBI |
| N-benzyl-4-sulfamoyl-benzamide | PDBeChem |
| Citations |
|---|