EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C12H20O10 |
| Net Charge | 0 |
| Average Mass | 324.282 |
| Monoisotopic Mass | 324.10565 |
| SMILES | OC[C@H]1O[C@]2(CO[C@]3(CO)O[C@H](CO)[C@@H](O)[C@@H]3O2)[C@@H](O)[C@@H]1O |
| WURCS | WURCS=2.0/1,2,2/[ha122h-2b_2-5]/1-1/a1-b2_a2-b3 |
| InChI | InChI=1S/C12H20O10/c13-1-5-7(16)9(18)12(21-5)4-19-11(3-15)10(22-12)8(17)6(2-14)20-11/h5-10,13-18H,1-4H2/t5-,6-,7-,8-,9+,10+,11-,12+/m1/s1 |
| InChIKey | KSRQDWNGXKYIDO-IYDDCBTQSA-N |
| Roles Classification |
|---|
| Biological Role: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| bis-β-D-fructofuranose 1,2':2,3'-dianhydride (CHEBI:4117) has functional parent β-D-fructofuranose (CHEBI:28645) |
| bis-β-D-fructofuranose 1,2':2,3'-dianhydride (CHEBI:4117) has role metabolite (CHEBI:25212) |
| bis-β-D-fructofuranose 1,2':2,3'-dianhydride (CHEBI:4117) is a sugar dianhydride (CHEBI:33922) |
| Synonym | Source |
|---|---|
| D-Fructofuranose 1,2':2,3'-dianhydride | KEGG COMPOUND |