EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C6H9NO2 |
| Net Charge | 0 |
| Average Mass | 127.143 |
| Monoisotopic Mass | 127.06333 |
| SMILES | C[C@@H]1C=CN[C@H]1C(=O)O |
| InChI | InChI=1S/C6H9NO2/c1-4-2-3-7-5(4)6(8)9/h2-5,7H,1H3,(H,8,9)/t4-,5-/m1/s1 |
| InChIKey | ZVJPMCWYCLEWPG-RFZPGFLSSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 4-methyl-2-pyrroline-5-carboxylic acid (CHEBI:41149) is a monocarboxylic acid (CHEBI:25384) |
| 4-methyl-2-pyrroline-5-carboxylic acid (CHEBI:41149) is a pyrroline (CHEBI:23763) |
| Incoming Relation(s) |
| 4-methyl-2-pyrroline-5-carboxylic acid residue (CHEBI:61979) is substituent group from 4-methyl-2-pyrroline-5-carboxylic acid (CHEBI:41149) |
| IUPAC Name |
|---|
| (2R,3R)-3-methyl-2,3-dihydro-1H-pyrrole-2-carboxylic acid |
| Manual Xrefs | Databases |
|---|---|
| BGX | PDBeChem |