EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C17H26N8O5 |
| Net Charge | 0 |
| Average Mass | 422.446 |
| Monoisotopic Mass | 422.20262 |
| SMILES | [H][C@]1(n2ccc(N)nc2=O)C=C[C@H](NC(=O)C[C@@H](N)CCN(C)C(=N)N)[C@@]([H])(C(=O)O)O1 |
| InChI | InChI=1S/C17H26N8O5/c1-24(16(20)21)6-4-9(18)8-12(26)22-10-2-3-13(30-14(10)15(27)28)25-7-5-11(19)23-17(25)29/h2-3,5,7,9-10,13-14H,4,6,8,18H2,1H3,(H3,20,21)(H,22,26)(H,27,28)(H2,19,23,29)/t9-,10-,13+,14-/m0/s1 |
| InChIKey | CXNPLSGKWMLZPZ-ZNIXKSQXSA-N |
| Wikipedia |
|---|
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Streptomyces griseochromogenes (ncbitaxon:68214) | - | PubMed (12964155) |
| Roles Classification |
|---|
| Biological Roles: | fungicide A substance used to destroy fungal pests. bacterial metabolite Any prokaryotic metabolite produced during a metabolic reaction in bacteria. protein synthesis inhibitor A compound, usually an anti-bacterial agent or a toxin, which inhibits the synthesis of a protein. antimicrobial agent A substance that kills or slows the growth of microorganisms, including bacteria, viruses, fungi and protozoans. antifungal agent An antimicrobial agent that destroys fungi by suppressing their ability to grow or reproduce. |
| Application: | fungicide A substance used to destroy fungal pests. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| blasticidin S (CHEBI:15353) has role antimicrobial agent (CHEBI:33281) |
| blasticidin S (CHEBI:15353) has role bacterial metabolite (CHEBI:76969) |
| blasticidin S (CHEBI:15353) has role fungicide (CHEBI:24127) |
| blasticidin S (CHEBI:15353) has role protein synthesis inhibitor (CHEBI:48001) |
| blasticidin S (CHEBI:15353) is a antibiotic antifungal agent (CHEBI:86478) |
| blasticidin S (CHEBI:15353) is a blasticidin (CHEBI:22905) |
| blasticidin S (CHEBI:15353) is conjugate base of blasticidin S(1+) (CHEBI:57289) |
| Incoming Relation(s) |
| acetylblasticidin S (CHEBI:2413) has functional parent blasticidin S (CHEBI:15353) |
| blasticidin S(1+) (CHEBI:57289) is conjugate acid of blasticidin S (CHEBI:15353) |
| IUPAC Name |
|---|
| 4-amino-1-(4-{[(3S)-3-amino-5-(N-methylcarbamimidamido)pentanoyl]amino}-2,3,4-trideoxy-β-D-erythro-hex-2-enopyranuronosyl)pyrimidin-2(1H)-one |
| Synonyms | Source |
|---|---|
| Blasticidin S | KEGG COMPOUND |
| Blasticidin-S | ChemIDplus |
| Manual Xrefs | Databases |
|---|---|
| C02010 | KEGG COMPOUND |
| C02010 | KEGG COMPOUND |
| BLS | PDBeChem |
| Blasticidin_S | Wikipedia |
| C00027948 | KNApSAcK |
| C00016063 | KNApSAcK |
| blasticidin-s | Alan Wood's Pesticides |
| HMDB0030452 | HMDB |
| blasticidin-s | MetaCyc |
| Registry Numbers | Sources |
|---|---|
| Reaxys:68255 | Reaxys |
| CAS:2079-00-7 | KEGG COMPOUND |
| CAS:2079-00-7 | ChemIDplus |
| Citations |
|---|