EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C9H11NO |
| Net Charge | 0 |
| Average Mass | 149.193 |
| Monoisotopic Mass | 149.08406 |
| SMILES | C[C@H](N)C(=O)c1ccccc1 |
| InChI | InChI=1S/C9H11NO/c1-7(10)9(11)8-5-3-2-4-6-8/h2-7H,10H2,1H3/t7-/m0/s1 |
| InChIKey | PUAQLLVFLMYYJJ-ZETCQYMHSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| Biological Role: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| Applications: | psychotropic drug A loosely defined grouping of drugs that have effects on psychological function. central nervous system stimulant Any drug that enhances the activity of the central nervous system. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| cathinone (CHEBI:4110) has role central nervous system stimulant (CHEBI:35337) |
| cathinone (CHEBI:4110) has role psychotropic drug (CHEBI:35471) |
| cathinone (CHEBI:4110) is a 2-aminopropiophenone (CHEBI:59332) |
| cathinone (CHEBI:4110) is a monoamine alkaloid (CHEBI:59333) |
| IUPAC Name |
|---|
| (2S)-2-amino-1-phenylpropan-1-one |
| INNs | Source |
|---|---|
| cathinone | ChemIDplus |
| cathinonum | ChemIDplus |
| catinona | ChemIDplus |
| Synonyms | Source |
|---|---|
| Cathinone | KEGG COMPOUND |
| D-Cathinone | KEGG COMPOUND |
| Norephedrone | ChemIDplus |
| Registry Numbers | Sources |
|---|---|
| CAS:71031-15-7 | KEGG COMPOUND |
| CAS:71031-15-7 | ChemIDplus |