EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C9H13NO |
| Net Charge | 0 |
| Average Mass | 151.209 |
| Monoisotopic Mass | 151.09971 |
| SMILES | C[C@H](N)[C@@H](O)c1ccccc1 |
| InChI | InChI=1S/C9H13NO/c1-7(10)9(11)8-5-3-2-4-6-8/h2-7,9,11H,10H2,1H3/t7-,9+/m0/s1 |
| InChIKey | DLNKOYKMWOXYQA-IONNQARKSA-N |
| Wikipedia |
|---|
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Catha edulis (ncbitaxon:123405) | leaf (BTO:0000713) | PubMed (33370655 ) |
| Roles Classification |
|---|
| Chemical Roles: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| Biological Roles: | plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| Applications: | central nervous system stimulant Any drug that enhances the activity of the central nervous system. psychotropic drug A loosely defined grouping of drugs that have effects on psychological function. central nervous system stimulant Any drug that enhances the activity of the central nervous system. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| cathine (CHEBI:4109) has role central nervous system stimulant (CHEBI:35337) |
| cathine (CHEBI:4109) has role plant metabolite (CHEBI:76924) |
| cathine (CHEBI:4109) has role psychotropic drug (CHEBI:35471) |
| cathine (CHEBI:4109) is a amphetamines (CHEBI:35338) |
| cathine (CHEBI:4109) is a phenethylamine alkaloid (CHEBI:38605) |
| IUPAC Name |
|---|
| (1S,2S)-2-amino-1-phenylpropan-1-ol |
| Synonyms | Source |
|---|---|
| (1S,2S)-2-amino-1-phenyl-1-propanol | ChEBI |
| (1S,2S)-(+)-norpseudoephedrine | ChEBI |
| (1S,2S)-norpseudoephedrine | ChEBI |
| (+)-cathine | ChEBI |
| d-norpseudoephedrine | ChemIDplus |
| katine | ChemIDplus |
| Citations |
|---|