EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C19H23N4O6PS |
| Net Charge | 0 |
| Average Mass | 466.456 |
| Monoisotopic Mass | 466.10759 |
| SMILES | [H]C(=O)N(Cc1cnc(C)nc1N)C(C)=C(CCOP(=O)(O)O)SC(=O)c1ccccc1 |
| InChI | InChI=1S/C19H23N4O6PS/c1-13(23(12-24)11-16-10-21-14(2)22-18(16)20)17(8-9-29-30(26,27)28)31-19(25)15-6-4-3-5-7-15/h3-7,10,12H,8-9,11H2,1-2H3,(H2,20,21,22)(H2,26,27,28) |
| InChIKey | BTNNPSLJPBRMLZ-UHFFFAOYSA-N |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Chemical Roles: | antioxidant A substance that opposes oxidation or inhibits reactions brought about by dioxygen or peroxides. Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| Biological Roles: | provitamin B1 A provitamin that can be converted into vitamin B1 by enzymes from animal tissues. immunological adjuvant A substance that augments, stimulates, activates, potentiates, or modulates the immune response at either the cellular or humoral level. A classical agent (Freund's adjuvant, BCG, Corynebacterium parvum, et al.) contains bacterial antigens. It could also be endogenous (e.g., histamine, interferon, transfer factor, tuftsin, interleukin-1). Its mode of action is either non-specific, resulting in increased immune responsiveness to a wide variety of antigens, or antigen-specific, i.e., affecting a restricted type of immune response to a narrow group of antigens. The therapeutic efficacy is related to its antigen-specific immunoadjuvanticity. |
| Applications: | protective agent Synthetic or natural substance which is given to prevent a disease or disorder or are used in the process of treating a disease or injury due to a poisonous agent. immunological adjuvant A substance that augments, stimulates, activates, potentiates, or modulates the immune response at either the cellular or humoral level. A classical agent (Freund's adjuvant, BCG, Corynebacterium parvum, et al.) contains bacterial antigens. It could also be endogenous (e.g., histamine, interferon, transfer factor, tuftsin, interleukin-1). Its mode of action is either non-specific, resulting in increased immune responsiveness to a wide variety of antigens, or antigen-specific, i.e., affecting a restricted type of immune response to a narrow group of antigens. The therapeutic efficacy is related to its antigen-specific immunoadjuvanticity. nutraceutical A product in capsule, tablet or liquid form that provide essential nutrients, such as a vitamin, an essential mineral, a protein, an herb, or similar nutritional substance. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| benfotiamine (CHEBI:41039) has functional parent thiamine(1+) (CHEBI:18385) |
| benfotiamine (CHEBI:41039) has role antioxidant (CHEBI:22586) |
| benfotiamine (CHEBI:41039) has role immunological adjuvant (CHEBI:50847) |
| benfotiamine (CHEBI:41039) has role nutraceutical (CHEBI:50733) |
| benfotiamine (CHEBI:41039) has role protective agent (CHEBI:50267) |
| benfotiamine (CHEBI:41039) has role provitamin B1 (CHEBI:72470) |
| benfotiamine (CHEBI:41039) is a aminopyrimidine (CHEBI:38338) |
| benfotiamine (CHEBI:41039) is a formamides (CHEBI:24079) |
| benfotiamine (CHEBI:41039) is a organic phosphate (CHEBI:25703) |
| benfotiamine (CHEBI:41039) is a thioester (CHEBI:51277) |
| IUPAC Name |
|---|
| S-[2-{[(4-amino-2-methylpyrimidin-5-yl)methyl](formyl)amino}-5-(phosphonooxy)pent-2-en-3-yl] benzenecarbothioate |
| INNs | Source |
|---|---|
| benfotiamina | ChemIDplus |
| benfotiamine | WHO MedNet |
| benfotiamine | KEGG DRUG |
| benfotiaminum | ChemIDplus |
| Synonyms | Source |
|---|---|
| Benphothiamine | ChemIDplus |
| Benzoylthiamine monophosphate | ChemIDplus |
| Benzoylthiamine O-monophosphate | ChemIDplus |
| N-((4-Amino-2-methyl-5-pyrimidinyl)methyl)-N-(4-hydroxy-2-mercapto-1-methyl-1-butenyl)formamide S-benzoate O-phosphate | ChemIDplus |
| S-Benzoylthiamine monophosphate | ChemIDplus |
| S-Benzoylthiamine O-monophosphate | ChemIDplus |
| Manual Xrefs | Databases |
|---|---|
| Benfotiamine | Wikipedia |
| BFT | PDBeChem |
| D01255 | KEGG DRUG |
| LSM-5213 | LINCS |
| US2006045896 | Patent |
| Registry Numbers | Sources |
|---|---|
| Reaxys:771326 | Reaxys |
| CAS:22457-89-2 | ChemIDplus |
| Citations |
|---|