EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C4H9NO3 |
| Net Charge | 0 |
| Average Mass | 119.120 |
| Monoisotopic Mass | 119.05824 |
| SMILES | N[C@@H](CO)CC(=O)O |
| InChI | InChI=1S/C4H9NO3/c5-3(2-6)1-4(7)8/h3,6H,1-2,5H2,(H,7,8)/t3-/m1/s1 |
| InChIKey | BUZICZZQJDLXJN-GSVOUGTGSA-N |
| Roles Classification |
|---|
| Chemical Roles: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| (3R)-3-amino-4-hydroxybutanoic acid (CHEBI:41011) is a hydroxy monocarboxylic acid (CHEBI:35868) |
| (3R)-3-amino-4-hydroxybutanoic acid (CHEBI:41011) is a β-amino acid (CHEBI:33706) |
| IUPAC Name |
|---|
| (3R)-3-amino-4-hydroxybutanoic acid |
| Manual Xrefs | Databases |
|---|---|
| B3S | PDBeChem |
| Registry Numbers | Sources |
|---|---|
| Reaxys:2689327 | Reaxys |