EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C5H9NO3 |
| Net Charge | 0 |
| Average Mass | 131.131 |
| Monoisotopic Mass | 131.05824 |
| SMILES | CC(=O)N[C@@H](C)C(=O)O |
| InChI | InChI=1S/C5H9NO3/c1-3(5(8)9)6-4(2)7/h3H,1-2H3,(H,6,7)(H,8,9)/t3-/m0/s1 |
| InChIKey | KTHDTJVBEPMMGL-VKHMYHEASA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Homo sapiens (ncbitaxon:9606) | - | PubMed (21886157) | |
| Saccharomyces cerevisiae (ncbitaxon:4932) | |||
| - | PubMed (17439666) | ||
| - | MetaboLights (MTBLS8) |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| Biological Roles: | human metabolite Any mammalian metabolite produced during a metabolic reaction in humans (Homo sapiens). Saccharomyces cerevisiae metabolite Any fungal metabolite produced during a metabolic reaction in Baker's yeast (Saccharomyces cerevisiae ). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| N-acetyl-L-alanine (CHEBI:40992) has role Saccharomyces cerevisiae metabolite (CHEBI:75772) |
| N-acetyl-L-alanine (CHEBI:40992) has role human metabolite (CHEBI:77746) |
| N-acetyl-L-alanine (CHEBI:40992) is a N-acetyl-L-amino acid (CHEBI:21545) |
| N-acetyl-L-alanine (CHEBI:40992) is a L-alanine derivative (CHEBI:83943) |
| N-acetyl-L-alanine (CHEBI:40992) is conjugate acid of N-acetyl-L-alaninate (CHEBI:133520) |
| Incoming Relation(s) |
| N-acetyl-L-alaninate (CHEBI:133520) is conjugate base of N-acetyl-L-alanine (CHEBI:40992) |
| N-acetyl-L-alanine residue (CHEBI:61920) is substituent group from N-acetyl-L-alanine (CHEBI:40992) |
| N-terminal N-acetyl-L-alanine residue (CHEBI:83683) is substituent group from N-acetyl-L-alanine (CHEBI:40992) |
| IUPAC Name |
|---|
| N-acetyl-L-alanine |
| Synonyms | Source |
|---|---|
| 2-Acetamidopropionic acid | ChemIDplus |
| Ac-Ala-OH | ChEBI |
| Acetylalanine | ChemIDplus |
| N-acetyl-L-α-alanine | NIST Chemistry WebBook |
| (S)-2-(acetylamino)propanoic acid | ChEBI |
| L-N-Acetylalanine | HMDB |
| Manual Xrefs | Databases |
|---|---|
| AYA | PDBeChem |
| DB02518 | DrugBank |
| HMDB0000766 | HMDB |
| Citations |
|---|