EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C40H52O4 |
| Net Charge | 0 |
| Average Mass | 596.852 |
| Monoisotopic Mass | 596.38656 |
| SMILES | CC1=C(/C=C/C(C)=C/C=C/C(C)=C/C=C/C=C(C)/C=C/C=C(C)/C=C/C2=C(C)C(=O)[C@@H](O)CC2(C)C)C(C)(C)C[C@H](O)C1=O |
| InChI | InChI=1S/C40H52O4/c1-27(17-13-19-29(3)21-23-33-31(5)37(43)35(41)25-39(33,7)8)15-11-12-16-28(2)18-14-20-30(4)22-24-34-32(6)38(44)36(42)26-40(34,9)10/h11-24,35-36,41-42H,25-26H2,1-10H3/b12-11+,17-13+,18-14+,23-21+,24-22+,27-15+,28-16+,29-19+,30-20+/t35-,36-/m0/s1 |
| InChIKey | MQZIGYBFDRPAKN-UWFIBFSHSA-N |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Chemical Roles: | food colouring A food additive that imparts colour to food. In European countries, E-numbers for permitted food colours are from E 100 to E 199, divided into yellows (E 100-109), oranges (E 110-119), reds (E 120-129), blues and violets (E 130-139), greens (E 140-149), browns and blacks (E 150-159), and others (E 160-199). antioxidant A substance that opposes oxidation or inhibits reactions brought about by dioxygen or peroxides. |
| Biological Roles: | food colouring A food additive that imparts colour to food. In European countries, E-numbers for permitted food colours are from E 100 to E 199, divided into yellows (E 100-109), oranges (E 110-119), reds (E 120-129), blues and violets (E 130-139), greens (E 140-149), browns and blacks (E 150-159), and others (E 160-199). plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. animal metabolite Any eukaryotic metabolite produced during a metabolic reaction in animals that include diverse creatures from sponges, insects to mammals. |
| Applications: | food colouring A food additive that imparts colour to food. In European countries, E-numbers for permitted food colours are from E 100 to E 199, divided into yellows (E 100-109), oranges (E 110-119), reds (E 120-129), blues and violets (E 130-139), greens (E 140-149), browns and blacks (E 150-159), and others (E 160-199). anticoagulant An agent that prevents blood clotting. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| astaxanthin (CHEBI:40968) has parent hydride β-carotene (CHEBI:17579) |
| astaxanthin (CHEBI:40968) has role animal metabolite (CHEBI:75767) |
| astaxanthin (CHEBI:40968) has role anticoagulant (CHEBI:50249) |
| astaxanthin (CHEBI:40968) has role antioxidant (CHEBI:22586) |
| astaxanthin (CHEBI:40968) has role food colouring (CHEBI:77182) |
| astaxanthin (CHEBI:40968) has role plant metabolite (CHEBI:76924) |
| astaxanthin (CHEBI:40968) is a carotenol (CHEBI:23045) |
| astaxanthin (CHEBI:40968) is a carotenone (CHEBI:35310) |
| Incoming Relation(s) |
| astaxanthin dirhamnoside (CHEBI:208633) has functional parent astaxanthin (CHEBI:40968) |
| IUPAC Name |
|---|
| (3S,3'S)-3,3'-dihydroxy-β,β-carotene-4,4'-dione |
| Synonyms | Source |
|---|---|
| 3,3'-dihydroxy-β-carotene-4,4'-dione | ChemIDplus |
| 3,3'-dihydroxy-β,β-carotene-4,4'-dione | ChemIDplus |
| (3S,3'S)-astaxanthin | ChemIDplus |
| Astaxanthin | KEGG COMPOUND |
| ASTAXANTHIN | PDBeChem |
| astaxanthine | ChemIDplus |
| UniProt Name | Source |
|---|---|
| all-trans-(3S,3'S)-astaxanthin | UniProt |
| Manual Xrefs | Databases |
|---|---|
| Astaxanthin | Wikipedia |
| AXT | PDBeChem |
| C00000918 | KNApSAcK |
| C08580 | KEGG COMPOUND |
| HMDB0002204 | HMDB |
| LMPR01070263 | LIPID MAPS |
| Registry Numbers | Sources |
|---|---|
| Reaxys:1917937 | Reaxys |
| Beilstein:1917937 | Beilstein |
| CAS:472-61-7 | ChemIDplus |
| CAS:472-61-7 | KEGG COMPOUND |
| Citations |
|---|