EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C6H13NO4 |
| Net Charge | 0 |
| Average Mass | 163.173 |
| Monoisotopic Mass | 163.08446 |
| SMILES | O=C(O)CN(CCO)CCO |
| InChI | InChI=1S/C6H13NO4/c8-3-1-7(2-4-9)5-6(10)11/h8-9H,1-5H2,(H,10,11) |
| InChIKey | FSVCELGFZIQNCK-UHFFFAOYSA-N |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Chemical Role: | Good's buffer substance Any member of a collection of zwitterionic buffer substances selected or devised for suitability in experimental biological systems according to a number of predetermined criteria. Named after Dr. Norman Good. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| N,N-bis(2-hydroxyethyl)glycine (CHEBI:40957) is a bicine (CHEBI:39065) |
| N,N-bis(2-hydroxyethyl)glycine (CHEBI:40957) is conjugate acid of [bis(2-hydroxyethyl)amino]acetate (CHEBI:39067) |
| N,N-bis(2-hydroxyethyl)glycine (CHEBI:40957) is tautomer of [bis(2-hydroxyethyl)ammonio]acetate (CHEBI:39066) |
| Incoming Relation(s) |
| [bis(2-hydroxyethyl)amino]acetate (CHEBI:39067) is conjugate base of N,N-bis(2-hydroxyethyl)glycine (CHEBI:40957) |
| [bis(2-hydroxyethyl)ammonio]acetate (CHEBI:39066) is tautomer of N,N-bis(2-hydroxyethyl)glycine (CHEBI:40957) |
| IUPAC Name |
|---|
| N,N-bis(2-hydroxyethyl)glycine |
| Synonyms | Source |
|---|---|
| Bicine | ChemIDplus |
| bicine buffer | ChEBI |
| Manual Xrefs | Databases |
|---|---|
| BCN | PDBeChem |
| HMDB0011727 | HMDB |
| Bicine | Wikipedia |
| DB03709 | DrugBank |
| Registry Numbers | Sources |
|---|---|
| Gmelin:3532 | Gmelin |
| Beilstein:1769362 | Beilstein |
| Reaxys:1769362 | Reaxys |
| CAS:150-25-4 | ChemIDplus |
| Citations |
|---|