EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C31H37N5O3 |
| Net Charge | 0 |
| Average Mass | 527.669 |
| Monoisotopic Mass | 527.28964 |
| SMILES | Cc1ccc(-n2nc(C(C)(C)C)cc2NC(=O)Nc2ccc(OCCN3CCOCC3)c3ccccc23)cc1 |
| InChI | InChI=1S/C31H37N5O3/c1-22-9-11-23(12-10-22)36-29(21-28(34-36)31(2,3)4)33-30(37)32-26-13-14-27(25-8-6-5-7-24(25)26)39-20-17-35-15-18-38-19-16-35/h5-14,21H,15-20H2,1-4H3,(H2,32,33,37) |
| InChIKey | MVCOAUNKQVWQHZ-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Biological Roles: | EC 2.7.11.24 (mitogen-activated protein kinase) inhibitor An EC 2.7.11.* (protein-serine/threonine kinase) inhibitor that interferes with the action of mitogen-activated protein kinase (EC 2.7.11.24). immunomodulator Biologically active substance whose activity affects or plays a role in the functioning of the immune system. |
| Application: | immunomodulator Biologically active substance whose activity affects or plays a role in the functioning of the immune system. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| doramapimod (CHEBI:40953) has role EC 2.7.11.24 (mitogen-activated protein kinase) inhibitor (CHEBI:79091) |
| doramapimod (CHEBI:40953) has role immunomodulator (CHEBI:50846) |
| doramapimod (CHEBI:40953) is a aromatic ether (CHEBI:35618) |
| doramapimod (CHEBI:40953) is a morpholines (CHEBI:38785) |
| doramapimod (CHEBI:40953) is a naphthalenes (CHEBI:25477) |
| doramapimod (CHEBI:40953) is a pyrazoles (CHEBI:26410) |
| doramapimod (CHEBI:40953) is a ureas (CHEBI:47857) |
| IUPAC Name |
|---|
| N-[3-tert-butyl-1-(4-methylphenyl)-1H-pyrazol-5-yl]-N'-{4-[2-(morpholin-4-yl)ethoxy]naphthalen-1-yl}urea |
| INN | Source |
|---|---|
| doramapimod | ChemIDplus |
| Synonyms | Source |
|---|---|
| 1-(3-(1,1-Dimethylethyl)-1-(4-methylphenyl)-1H-pyrazol-5-yl)-3-(4-(2-(morpholin-4-yl)ethoxy)naphthalen-1-yl)urea | ChemIDplus |
| 1-[3-tert-butyl-1-(4-methylphenyl)-1H-pyrazol-5-yl]-3-[4-(2-morpholin-4-ylethoxy)naphthalen-1-yl]urea | PDBeChem |
| BIRB 796 | ChemIDplus |
| BIRB-796 | ChemIDplus |
| Registry Numbers | Sources |
|---|---|
| Reaxys:9170597 | Reaxys |
| CAS:285983-48-4 | ChemIDplus |
| Citations |
|---|