EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C19H30O |
| Net Charge | 0 |
| Average Mass | 274.448 |
| Monoisotopic Mass | 274.22967 |
| SMILES | [H][C@@]12CC[C@]3([H])[C@]([H])(CC[C@]4(C)C=CC[C@@]34[H])[C@@]1(C)CC[C@@H](O)C2 |
| InChI | InChI=1S/C19H30O/c1-18-9-3-4-16(18)15-6-5-13-12-14(20)7-11-19(13,2)17(15)8-10-18/h3,9,13-17,20H,4-8,10-12H2,1-2H3/t13-,14+,15-,16-,17-,18-,19-/m0/s1 |
| InChIKey | KRVXMNNRSSQZJP-PHFHYRSDSA-N |
| Roles Classification |
|---|
| Biological Role: | pheromone A semiochemical used in olfactory communication between organisms of the same species eliciting a change in sexual or social behaviour. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 5α-androst-16-en-3α-ol (CHEBI:40933) has parent hydride 5α-androst-16-ene (CHEBI:37927) |
| 5α-androst-16-en-3α-ol (CHEBI:40933) has role pheromone (CHEBI:26013) |
| 5α-androst-16-en-3α-ol (CHEBI:40933) is a 3α-sterol (CHEBI:35347) |
| IUPAC Name |
|---|
| 5α-androst-16-en-3α-ol |
| Synonyms | Source |
|---|---|
| (3alpha,5alpha)-Androst-16-en-3-ol | ChemIDplus |
| 3alpha-Hydroxyandrost-16-ene | ChemIDplus |
| androstenol | ChEBI |
| Androst-16-en-3α-ol | LIPID MAPS |
| Manual Xrefs | Databases |
|---|---|
| LMST02020008 | LIPID MAPS |
| DB01889 | DrugBank |
| LSM-5400 | LINCS |
| Registry Numbers | Sources |
|---|---|
| CAS:1153-51-1 | ChemIDplus |