EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C2H7O3P |
| Net Charge | 0 |
| Average Mass | 110.049 |
| Monoisotopic Mass | 110.01328 |
| SMILES | [H]P(=O)(O)OCC |
| InChI | InChI=1S/C2H7O3P/c1-2-5-6(3)4/h6H,2H2,1H3,(H,3,4) |
| InChIKey | VUERQRKTYBIULR-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Biological Role: | antifungal agrochemical Any substance used in acriculture, horticulture, forestry, etc. for its fungicidal properties. |
| Application: | antifungal agrochemical Any substance used in acriculture, horticulture, forestry, etc. for its fungicidal properties. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| fosetyl (CHEBI:40926) has role antifungal agrochemical (CHEBI:86328) |
| fosetyl (CHEBI:40926) is a phosphonic ester (CHEBI:37735) |
| fosetyl (CHEBI:40926) is conjugate acid of fosetyl(1−) (CHEBI:84034) |
| Incoming Relation(s) |
| fosetyl(1−) (CHEBI:84034) is conjugate base of fosetyl (CHEBI:40926) |
| IUPAC Name |
|---|
| ethyl hydrogen phosphonate |
| Synonyms | Source |
|---|---|
| ethyl phosphinic acid | ChEBI |
| Monoethyl phosphonate | ChemIDplus |
| Phosphonic acid, monoethyl ester | ChemIDplus |
| Registry Numbers | Sources |
|---|---|
| Reaxys:969557 | Reaxys |
| CAS:15845-66-6 | KEGG COMPOUND |
| CAS:15845-66-6 | ChemIDplus |