EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
CHEBI:40909 - azoxystrobin
| Formula | C22H17N3O5 |
| Net Charge | 0 |
| Average Mass | 403.394 |
| Monoisotopic Mass | 403.11682 |
| SMILES | CO/C=C(/C(=O)OC)c1ccccc1Oc1cc(Oc2ccccc2C#N)ncn1 |
| InChI | InChI=1S/C22H17N3O5/c1-27-13-17(22(26)28-2)16-8-4-6-10-19(16)30-21-11-20(24-14-25-21)29-18-9-5-3-7-15(18)12-23/h3-11,13-14H,1-2H3/b17-13+ |
| InChIKey | WFDXOXNFNRHQEC-GHRIWEEISA-N |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Chemical Role: | environmental contaminant Any minor or unwanted substance introduced into the environment that can have undesired effects. |
| Biological Roles: | xenobiotic A xenobiotic (Greek, xenos "foreign"; bios "life") is a compound that is foreign to a living organism. Principal xenobiotics include: drugs, carcinogens and various compounds that have been introduced into the environment by artificial means. antifungal agrochemical Any substance used in acriculture, horticulture, forestry, etc. for its fungicidal properties. quinone outside inhibitor A mitochondrial cytochrome-bc1 complex inhibitor that acts at the Quinone 'outer' (Qo) binding site of the cytochrome-bc1 complex. antifungal agent An antimicrobial agent that destroys fungi by suppressing their ability to grow or reproduce. antifungal agent An antimicrobial agent that destroys fungi by suppressing their ability to grow or reproduce. antifungal agent An antimicrobial agent that destroys fungi by suppressing their ability to grow or reproduce. antifungal agent An antimicrobial agent that destroys fungi by suppressing their ability to grow or reproduce. antifungal agent An antimicrobial agent that destroys fungi by suppressing their ability to grow or reproduce. antifungal agent An antimicrobial agent that destroys fungi by suppressing their ability to grow or reproduce. antifungal agent An antimicrobial agent that destroys fungi by suppressing their ability to grow or reproduce. |
| Applications: | antifungal agrochemical Any substance used in acriculture, horticulture, forestry, etc. for its fungicidal properties. quinone outside inhibitor A mitochondrial cytochrome-bc1 complex inhibitor that acts at the Quinone 'outer' (Qo) binding site of the cytochrome-bc1 complex. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| azoxystrobin (CHEBI:40909) has role antifungal agrochemical (CHEBI:86328) |
| azoxystrobin (CHEBI:40909) has role environmental contaminant (CHEBI:78298) |
| azoxystrobin (CHEBI:40909) has role mitochondrial cytochrome-bc1 complex inhibitor (CHEBI:38499) |
| azoxystrobin (CHEBI:40909) has role quinone outside inhibitor (CHEBI:141153) |
| azoxystrobin (CHEBI:40909) has role xenobiotic (CHEBI:35703) |
| azoxystrobin (CHEBI:40909) is a aryloxypyrimidine (CHEBI:48535) |
| azoxystrobin (CHEBI:40909) is a enoate ester (CHEBI:51702) |
| azoxystrobin (CHEBI:40909) is a enol ether (CHEBI:47985) |
| azoxystrobin (CHEBI:40909) is a methoxyacrylate strobilurin antifungal agent (CHEBI:86484) |
| azoxystrobin (CHEBI:40909) is a methyl ester (CHEBI:25248) |
| azoxystrobin (CHEBI:40909) is a nitrile (CHEBI:18379) |
| IUPAC Name |
|---|
| methyl (2E)-2-(2-{[6-(2-cyanophenoxy)pyrimidin-4-yl]oxy}phenyl)-3-methoxyprop-2-enoate |
| Synonyms | Source |
|---|---|
| methyl (E)-2-[2-[6-(2-cyanophenoxy)pyrimidin-4-yloxy]phenyl]-3-methoxyacrylate | ChEBI |
| (αE)-2-[[6-(2-cyanophenoxy)-4-pyrimidinyl]oxy]-α-(methoxymethylene) benzeneacetic acid methyl ester | ChEBI |
| Manual Xrefs | Databases |
|---|---|
| 54 | PPDB |
| AZO | PDBeChem |
| azoxystrobin | Alan Wood's Pesticides |
| Azoxystrobin | Wikipedia |
| C18558 | KEGG COMPOUND |
| EP382375 | Patent |
| US5395837 | Patent |
| Registry Numbers | Sources |
|---|---|
| Reaxys:8350244 | Reaxys |
| CAS:131860-33-8 | KEGG COMPOUND |
| CAS:131860-33-8 | ChemIDplus |
| Citations |
|---|