EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
CHEBI:40863 - 3,4-dihydroxy-9,10-dioxo-9,10-dihydroanthracene-2-sulfonic acid
| Formula | C14H8O7S |
| Net Charge | 0 |
| Average Mass | 320.278 |
| Monoisotopic Mass | 319.99907 |
| SMILES | O=C1c2ccccc2C(=O)c2c1cc(S(=O)(=O)O)c(O)c2O |
| InChI | InChI=1S/C14H8O7S/c15-11-6-3-1-2-4-7(6)12(16)10-8(11)5-9(22(19,20)21)13(17)14(10)18/h1-5,17-18H,(H,19,20,21) |
| InChIKey | JKYKXTRKURYNGW-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Application: | histological dye A dye used in microscopic or electron microscopic examination of cells and tissues to give contrast and to highlight particular features of interest, such as nuclei and cytoplasm. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 3,4-dihydroxy-9,10-dioxo-9,10-dihydroanthracene-2-sulfonic acid (CHEBI:40863) has role histological dye (CHEBI:77178) |
| 3,4-dihydroxy-9,10-dioxo-9,10-dihydroanthracene-2-sulfonic acid (CHEBI:40863) is a dihydroxyanthraquinone (CHEBI:37484) |
| 3,4-dihydroxy-9,10-dioxo-9,10-dihydroanthracene-2-sulfonic acid (CHEBI:40863) is a organosulfonic acid (CHEBI:33551) |
| 3,4-dihydroxy-9,10-dioxo-9,10-dihydroanthracene-2-sulfonic acid (CHEBI:40863) is conjugate acid of 3,4-dihydroxy-9,10-dioxo-9,10-dihydroanthracene-2-sulfonate (CHEBI:87361) |
| Incoming Relation(s) |
| 3,4-dihydroxy-9,10-dioxo-9,10-dihydroanthracene-2-sulfonate (CHEBI:87361) is conjugate base of 3,4-dihydroxy-9,10-dioxo-9,10-dihydroanthracene-2-sulfonic acid (CHEBI:40863) |
| IUPAC Name |
|---|
| 3,4-dihydroxy-9,10-dioxo-9,10-dihydroanthracene-2-sulfonic acid |
| Synonyms | Source |
|---|---|
| Alizarin Red S (free acid) | ChEBI |
| 1,2-Dihydroxy-3-sulfoanthraquinone | ChemIDplus |
| 1,2-Dihydroxy-3-sulfonate-9,10-anthraquinone | ChemIDplus |
| 3,4-Dihydroxy-2-anthraquinonesulfonic acid | ChemIDplus |
| 3,4-Dihydroxy-9,10-anthraquinone-2-sulfonic acid | ChemIDplus |
| 3,4-Dihydroxy-9,10-dioxo-2-anthracenesulfonic acid | ChemIDplus |
| Citations |
|---|