EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C5H6O6 |
| Net Charge | 0 |
| Average Mass | 162.097 |
| Monoisotopic Mass | 162.01644 |
| SMILES | O=C(O)C(=O)C[C@@H](O)C(=O)O |
| InChI | InChI=1S/C5H6O6/c6-2(4(8)9)1-3(7)5(10)11/h2,6H,1H2,(H,8,9)(H,10,11)/t2-/m1/s1 |
| InChIKey | WXSKVKPSMAHCSG-UWTATZPHSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| D-4-hydroxy-2-oxoglutaric acid (CHEBI:4083) is a 4-hydroxy-2-oxoglutaric acid (CHEBI:30923) |
| D-4-hydroxy-2-oxoglutaric acid (CHEBI:4083) is conjugate acid of D-4-hydroxy-2-oxoglutarate(2−) (CHEBI:62213) |
| Incoming Relation(s) |
| D-4-hydroxy-2-oxoglutarate(2−) (CHEBI:62213) is conjugate base of D-4-hydroxy-2-oxoglutaric acid (CHEBI:4083) |
| IUPAC Name |
|---|
| (2R)-2-hydroxy-4-oxopentanedioic acid |
| Synonyms | Source |
|---|---|
| D-4-hydroxy-2-ketoglutaric acid | ChEBI |
| (R)-2-hydroxy-4-ketopentanedioic acid | ChEBI |
| (R)-2-hydroxy-4-oxopentanedioic acid | ChEBI |
| Manual Xrefs | Databases |
|---|---|
| C05946 | KEGG COMPOUND |