EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C9H13N3O5 |
| Net Charge | 0 |
| Average Mass | 243.219 |
| Monoisotopic Mass | 243.08552 |
| SMILES | Nc1ccn([C@@H]2O[C@H](CO)[C@@H](O)[C@@H]2O)c(=O)n1 |
| InChI | InChI=1S/C9H13N3O5/c10-5-1-2-12(9(16)11-5)8-7(15)6(14)4(3-13)17-8/h1-2,4,6-8,13-15H,3H2,(H2,10,11,16)/t4-,6-,7+,8-/m1/s1 |
| InChIKey | UHDGCWIWMRVCDJ-CCXZUQQUSA-N |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Biological Roles: | antimetabolite A substance which is structurally similar to a metabolite but which competes with it or replaces it, and so prevents or reduces its normal utilization. antiviral agent A substance that destroys or inhibits replication of viruses. immunosuppressive agent An agent that suppresses immune function by one of several mechanisms of action. Classical cytotoxic immunosuppressants act by inhibiting DNA synthesis. Others may act through activation of T-cells or by inhibiting the activation of helper cells. In addition, an immunosuppressive agent is a role played by a compound which is exhibited by a capability to diminish the extent and/or voracity of an immune response. |
| Applications: | antineoplastic agent A substance that inhibits or prevents the proliferation of neoplasms. immunosuppressive agent An agent that suppresses immune function by one of several mechanisms of action. Classical cytotoxic immunosuppressants act by inhibiting DNA synthesis. Others may act through activation of T-cells or by inhibiting the activation of helper cells. In addition, an immunosuppressive agent is a role played by a compound which is exhibited by a capability to diminish the extent and/or voracity of an immune response. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| cytarabine (CHEBI:28680) has functional parent cytosine (CHEBI:16040) |
| cytarabine (CHEBI:28680) has role antimetabolite (CHEBI:35221) |
| cytarabine (CHEBI:28680) has role antineoplastic agent (CHEBI:35610) |
| cytarabine (CHEBI:28680) has role antiviral agent (CHEBI:22587) |
| cytarabine (CHEBI:28680) has role immunosuppressive agent (CHEBI:35705) |
| cytarabine (CHEBI:28680) is a monosaccharide derivative (CHEBI:63367) |
| cytarabine (CHEBI:28680) is a pyrimidine nucleoside (CHEBI:26440) |
| cytarabine (CHEBI:28680) is a β-D-arabinoside (CHEBI:38315) |
| IUPAC Name |
|---|
| 4-amino-1-β-D-arabinofuranosylpyrimidin-2(1H)-one |
| INNs | Source |
|---|---|
| citarabina | ChemIDplus |
| cytarabine | WHO MedNet |
| cytarabine | ChemIDplus |
| cytarabinum | ChemIDplus |
| Synonyms | Source |
|---|---|
| 1-beta-D-Arabinofuranosylcytosine | ChemIDplus |
| 4-Amino-1-beta-D-arabinofuranosyl-2(1H)-pyrimidinone | ChemIDplus |
| arabinocytosine | DrugCentral |
| Arabinoside C | DrugCentral |
| ara-C | ChEBI |
| Cytarabine | KEGG COMPOUND |
| Manual Xrefs | Databases |
|---|---|
| 770 | DrugCentral |
| AR3 | PDBeChem |
| C02961 | KEGG COMPOUND |
| Cytarabine | Wikipedia |
| D00168 | KEGG DRUG |
| DB00987 | DrugBank |
| HMDB0015122 | HMDB |
| LSM-5470 | LINCS |
| Registry Numbers | Sources |
|---|---|
| Reaxys:89175 | Reaxys |
| CAS:147-94-4 | KEGG COMPOUND |
| CAS:147-94-4 | ChemIDplus |
| Citations |
|---|