EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C9H13N3O5 |
| Net Charge | 0 |
| Average Mass | 243.219 |
| Monoisotopic Mass | 243.08552 |
| SMILES | Nc1ccn([C@@H]2O[C@H](CO)[C@@H](O)[C@@H]2O)c(=O)n1 |
| InChI | InChI=1S/C9H13N3O5/c10-5-1-2-12(9(16)11-5)8-7(15)6(14)4(3-13)17-8/h1-2,4,6-8,13-15H,3H2,(H2,10,11,16)/t4-,6-,7+,8-/m1/s1 |
| InChIKey | UHDGCWIWMRVCDJ-CCXZUQQUSA-N |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Biological Roles: | antimetabolite A substance which is structurally similar to a metabolite but which competes with it or replaces it, and so prevents or reduces its normal utilization. immunosuppressive agent An agent that suppresses immune function by one of several mechanisms of action. Classical cytotoxic immunosuppressants act by inhibiting DNA synthesis. Others may act through activation of T-cells or by inhibiting the activation of helper cells. In addition, an immunosuppressive agent is a role played by a compound which is exhibited by a capability to diminish the extent and/or voracity of an immune response. antiviral agent A substance that destroys or inhibits replication of viruses. antimalarial A drug used in the treatment of malaria. Antimalarials are usually classified on the basis of their action against Plasmodia at different stages in their life cycle in the human. |
| Applications: | immunosuppressive agent An agent that suppresses immune function by one of several mechanisms of action. Classical cytotoxic immunosuppressants act by inhibiting DNA synthesis. Others may act through activation of T-cells or by inhibiting the activation of helper cells. In addition, an immunosuppressive agent is a role played by a compound which is exhibited by a capability to diminish the extent and/or voracity of an immune response. anti-anaemic agent A compound which increases either the number of red cells or the amount of haemoglobin in the blood. antineoplastic agent A substance that inhibits or prevents the proliferation of neoplasms. anti-inflammatory agent Any compound that has anti-inflammatory effects. antimalarial A drug used in the treatment of malaria. Antimalarials are usually classified on the basis of their action against Plasmodia at different stages in their life cycle in the human. antifibrotic agent Any agent which acts to reduce fibrosis. anticoagulant An agent that prevents blood clotting. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| cytarabine (CHEBI:28680) has functional parent cytosine (CHEBI:16040) |
| cytarabine (CHEBI:28680) has role anti-anaemic agent (CHEBI:75835) |
| cytarabine (CHEBI:28680) has role anti-inflammatory agent (CHEBI:67079) |
| cytarabine (CHEBI:28680) has role anticoagulant (CHEBI:50249) |
| cytarabine (CHEBI:28680) has role antifibrotic agent (CHEBI:233423) |
| cytarabine (CHEBI:28680) has role antimalarial (CHEBI:38068) |
| cytarabine (CHEBI:28680) has role antimetabolite (CHEBI:35221) |
| cytarabine (CHEBI:28680) has role antineoplastic agent (CHEBI:35610) |
| cytarabine (CHEBI:28680) has role antiviral agent (CHEBI:22587) |
| cytarabine (CHEBI:28680) has role immunosuppressive agent (CHEBI:35705) |
| cytarabine (CHEBI:28680) is a monosaccharide derivative (CHEBI:63367) |
| cytarabine (CHEBI:28680) is a pyrimidine nucleoside (CHEBI:26440) |
| cytarabine (CHEBI:28680) is a β-D-arabinoside (CHEBI:38315) |
| IUPAC Name |
|---|
| 4-amino-1-β-D-arabinofuranosylpyrimidin-2(1H)-one |
| INNs | Source |
|---|---|
| citarabina | ChemIDplus |
| cytarabine | ChemIDplus |
| cytarabine | WHO MedNet |
| cytarabinum | ChemIDplus |
| Synonyms | Source |
|---|---|
| 1-beta-D-Arabinofuranosylcytosine | ChemIDplus |
| 4-Amino-1-beta-D-arabinofuranosyl-2(1H)-pyrimidinone | ChemIDplus |
| arabinocytosine | DrugCentral |
| Arabinoside C | DrugCentral |
| Arabinosyl cytosine | ChEMBL |
| ara-C | ChEBI |
| Brand Names | Source |
|---|---|
| Alexan | ChEMBL |
| Alexan 100 | ChEMBL |
| Cytarabine component of vyxeos | ChEMBL |
| Cytosar | ChEMBL |
| Cytosar-u | ChEMBL |
| Depocyt | ChEMBL |
| Manual Xrefs | Databases |
|---|---|
| 770 | DrugCentral |
| AR3 | PDBeChem |
| C02961 | KEGG COMPOUND |
| Cytarabine | Wikipedia |
| D00168 | KEGG DRUG |
| DB00987 | DrugBank |
| HMDB0015122 | HMDB |
| LSM-5470 | LINCS |
| Registry Numbers | Sources |
|---|---|
| Reaxys:89175 | Reaxys |
| CAS:147-94-4 | KEGG COMPOUND |
| CAS:147-94-4 | ChemIDplus |
| Citations |
|---|