EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C34H55NO3 |
| Net Charge | 0 |
| Average Mass | 525.818 |
| Monoisotopic Mass | 525.41819 |
| SMILES | [H][C@@]12CC[C@H](O)[C@@]1(C)CC[C@]1([H])c3ccc(O)cc3C[C@@H](CCCCCCCCCCC(=O)N(C)CCCC)[C@@]21[H] |
| InChI | InChI=1S/C34H55NO3/c1-4-5-22-35(3)32(38)15-13-11-9-7-6-8-10-12-14-25-23-26-24-27(36)16-17-28(26)29-20-21-34(2)30(33(25)29)18-19-31(34)37/h16-17,24-25,29-31,33,36-37H,4-15,18-23H2,1-3H3/t25-,29-,30+,31+,33-,34+/m1/s1 |
| InChIKey | BVVFOLSZMQVDKV-KXQIQQEYSA-N |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Biological Role: | estrogen receptor antagonist An antagonist at the estrogen receptor. |
| Applications: | anti-estrogen A drug which acts to reduce estrogenic activity in the body, either by reducing the amount of estrogen or by reducing the activity of whatever estrogen is present. antineoplastic agent A substance that inhibits or prevents the proliferation of neoplasms. estrogen receptor antagonist An antagonist at the estrogen receptor. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| ICI-164384 (CHEBI:40710) has functional parent 17β-estradiol (CHEBI:16469) |
| ICI-164384 (CHEBI:40710) has role anti-estrogen (CHEBI:50751) |
| ICI-164384 (CHEBI:40710) has role antineoplastic agent (CHEBI:35610) |
| ICI-164384 (CHEBI:40710) has role estrogen receptor antagonist (CHEBI:50792) |
| ICI-164384 (CHEBI:40710) is a 17β-hydroxy steroid (CHEBI:35343) |
| ICI-164384 (CHEBI:40710) is a 3-hydroxy steroid (CHEBI:36834) |
| ICI-164384 (CHEBI:40710) is a tertiary carboxamide (CHEBI:140326) |
| IUPAC Name |
|---|
| N-butyl-11-[3,17β-dihydroxyestra-1(10),2,4-trien-7α-yl]-N-methylundecanamide |
| Synonyms | Source |
|---|---|
| ICI 164384 | ChemIDplus |
| N-n-butyl-N-methyl-11-(3,17β-dihydroxyestra-1,3,5(10)-trien-7α-yl)undecanamide | ChEBI |
| N-butyl-11-[(7R,8R,9S,13S,14S,17S)-3,17-dihydroxy-13-methyl-6,7,8,9,11,12,14,15,16,17-decahydrocyclopenta[a]phenanthren-7-yl]-N-methyl-undecanamide | PDBeChem |
| N-butyl-11-[(7α,9β,13α,14β,17α)-3,17-dihydroxyestra-1,3,5(10)-trien-7-yl]-N-methylundecanamide | PDBeChem |
| ICI M164384 | ChemIDplus |
| ICI 164,384 | ChemIDplus |
| Manual Xrefs | Databases |
|---|---|
| AOE | PDBeChem |
| C14758 | KEGG COMPOUND |
| DB03860 | DrugBank |
| ICI-164384 | Wikipedia |
| 94580 | ChemSpider |
| Registry Numbers | Sources |
|---|---|
| CAS:98007-99-9 | ChemIDplus |
| CAS:98007-99-9 | KEGG COMPOUND |
| Citations |
|---|