EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C34H55NO3 |
| Net Charge | 0 |
| Average Mass | 525.818 |
| Monoisotopic Mass | 525.41819 |
| SMILES | [H][C@@]12CC[C@H](O)[C@@]1(C)CC[C@]1([H])c3ccc(O)cc3C[C@@H](CCCCCCCCCCC(=O)N(C)CCCC)[C@@]21[H] |
| InChI | InChI=1S/C34H55NO3/c1-4-5-22-35(3)32(38)15-13-11-9-7-6-8-10-12-14-25-23-26-24-27(36)16-17-28(26)29-20-21-34(2)30(33(25)29)18-19-31(34)37/h16-17,24-25,29-31,33,36-37H,4-15,18-23H2,1-3H3/t25-,29-,30+,31+,33-,34+/m1/s1 |
| InChIKey | BVVFOLSZMQVDKV-KXQIQQEYSA-N |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Biological Role: | estrogen receptor antagonist An antagonist at the estrogen receptor. |
| Applications: | anti-estrogen A drug which acts to reduce estrogenic activity in the body, either by reducing the amount of estrogen or by reducing the activity of whatever estrogen is present. estrogen receptor antagonist An antagonist at the estrogen receptor. antineoplastic agent A substance that inhibits or prevents the proliferation of neoplasms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| ICI-164384 (CHEBI:40710) has functional parent 17β-estradiol (CHEBI:16469) |
| ICI-164384 (CHEBI:40710) has role anti-estrogen (CHEBI:50751) |
| ICI-164384 (CHEBI:40710) has role antineoplastic agent (CHEBI:35610) |
| ICI-164384 (CHEBI:40710) has role estrogen receptor antagonist (CHEBI:50792) |
| ICI-164384 (CHEBI:40710) is a 17β-hydroxy steroid (CHEBI:35343) |
| ICI-164384 (CHEBI:40710) is a 3-hydroxy steroid (CHEBI:36834) |
| ICI-164384 (CHEBI:40710) is a tertiary carboxamide (CHEBI:140326) |
| IUPAC Name |
|---|
| N-butyl-11-[3,17β-dihydroxyestra-1(10),2,4-trien-7α-yl]-N-methylundecanamide |
| Synonyms | Source |
|---|---|
| N-butyl-11-[(7R,8R,9S,13S,14S,17S)-3,17-dihydroxy-13-methyl-6,7,8,9,11,12,14,15,16,17-decahydrocyclopenta[a]phenanthren-7-yl]-N-methyl-undecanamide | PDBeChem |
| N-butyl-11-[(7α,9β,13α,14β,17α)-3,17-dihydroxyestra-1,3,5(10)-trien-7-yl]-N-methylundecanamide | PDBeChem |
| N-n-butyl-N-methyl-11-(3,17β-dihydroxyestra-1,3,5(10)-trien-7α-yl)undecanamide | ChEBI |
| N-n-butyl-N-methyl-11-[3,17β-dihydroxyestra-1,3,5(10)-trien-7α-yl]undecanamide | KEGG COMPOUND |
| ICI 164,384 | ChemIDplus |
| ICI 164384 | ChemIDplus |
| Manual Xrefs | Databases |
|---|---|
| 94580 | ChemSpider |
| AOE | PDBeChem |
| C14758 | KEGG COMPOUND |
| DB03860 | DrugBank |
| ICI-164384 | Wikipedia |
| Registry Numbers | Sources |
|---|---|
| CAS:98007-99-9 | KEGG COMPOUND |
| CAS:98007-99-9 | ChemIDplus |
| Citations |
|---|