EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C17H23N7O5 |
| Net Charge | 0 |
| Average Mass | 405.415 |
| Monoisotopic Mass | 405.17607 |
| SMILES | CN1CCC(CC(=O)N[C@H]2C=C[C@H](n3ccc(N)nc3=O)O[C@@H]2C(=O)O)NC1=N |
| InChI | InChI=1S/C17H23N7O5/c1-23-6-4-9(20-16(23)19)8-12(25)21-10-2-3-13(29-14(10)15(26)27)24-7-5-11(18)22-17(24)28/h2-3,5,7,9-10,13-14H,4,6,8H2,1H3,(H2,19,20)(H,21,25)(H,26,27)(H2,18,22,28)/t9?,10-,13+,14-/m0/s1 |
| InChIKey | NXYZPLILSHUEBR-LBLJTAPMSA-N |
| Roles Classification |
|---|
| Chemical Roles: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Cytomycin (CHEBI:4071) is a amino acid (CHEBI:33709) |
| Cytomycin (CHEBI:4071) is a oxacycle (CHEBI:38104) |
| Synonym | Source |
|---|---|
| Cytomycin | KEGG COMPOUND |
| Manual Xrefs | Databases |
|---|---|
| C01567 | KEGG COMPOUND |
| Registry Numbers | Sources |
|---|---|
| CAS:2005-98-3 | KEGG COMPOUND |