EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C5H10BO7 |
| Net Charge | -1 |
| Average Mass | 192.940 |
| Monoisotopic Mass | 193.05251 |
| SMILES | C[C@]12OC[C@H](O)[C@@]1(O)O[B-](O)(O)O2 |
| InChI | InChI=1S/C5H10BO7/c1-4-5(8,3(7)2-11-4)13-6(9,10)12-4/h3,7-10H,2H2,1H3/q-1/t3-,4+,5+/m0/s1 |
| InChIKey | ACKRRKSNOOISSG-VPENINKCSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Vibrio harveyi (ncbitaxon:669) | - | PubMed (23305926) |
| Roles Classification |
|---|
| Biological Roles: | autoinducer A signalling molecule produced and used by bacteria participating in quorum sensing, that is, in cell-cell communication to coordinate community-wide regulation of processes such as biofilm formation, virulence, and bioluminescence in populations of bacteria. Such communication can occur both within and between different species of bacteria. bacterial metabolite Any prokaryotic metabolite produced during a metabolic reaction in bacteria. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| autoinducer-2 (CHEBI:40646) has role autoinducer (CHEBI:71338) |
| autoinducer-2 (CHEBI:40646) has role bacterial metabolite (CHEBI:76969) |
| autoinducer-2 (CHEBI:40646) is a organic anion (CHEBI:25696) |
| IUPAC Name |
|---|
| dihydroxy[(2S,3R,4S)-2-methyldihydrofuran-2,3,3,4(2H)-tetrolato(2-)-κ2O2,O3]borate(1−) |
| Synonyms | Source |
|---|---|
| (3aS,6S,6aR)-2,2,6,6a-tetrahydroxy-3a-methyltetrahydrofuro[3,2-d][1,3,2]dioxaborolan-2-uide | ChEBI |
| AI-2 | KEGG COMPOUND |
| Autoinducer 2 | KEGG COMPOUND |
| Citations |
|---|