EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C5H10BO7 |
| Net Charge | -1 |
| Average Mass | 192.940 |
| Monoisotopic Mass | 193.05251 |
| SMILES | C[C@]12OC[C@H](O)[C@@]1(O)O[B-](O)(O)O2 |
| InChI | InChI=1S/C5H10BO7/c1-4-5(8,3(7)2-11-4)13-6(9,10)12-4/h3,7-10H,2H2,1H3/q-1/t3-,4+,5+/m0/s1 |
| InChIKey | ACKRRKSNOOISSG-VPENINKCSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Vibrio harveyi (ncbitaxon:669) | - | PubMed (23305926) |
| Roles Classification |
|---|
| Biological Roles: | bacterial metabolite Any prokaryotic metabolite produced during a metabolic reaction in bacteria. autoinducer A signalling molecule produced and used by bacteria participating in quorum sensing, that is, in cell-cell communication to coordinate community-wide regulation of processes such as biofilm formation, virulence, and bioluminescence in populations of bacteria. Such communication can occur both within and between different species of bacteria. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| autoinducer-2 (CHEBI:40646) has role autoinducer (CHEBI:71338) |
| autoinducer-2 (CHEBI:40646) has role bacterial metabolite (CHEBI:76969) |
| autoinducer-2 (CHEBI:40646) is a organic anion (CHEBI:25696) |
| IUPAC Name |
|---|
| dihydroxy[(2S,3R,4S)-2-methyldihydrofuran-2,3,3,4(2H)-tetrolato(2-)-κ2O2,O3]borate(1−) |
| Synonyms | Source |
|---|---|
| (3aS,6S,6aR)-2,2,6,6a-tetrahydroxy-3a-methyltetrahydrofuro[3,2-d][1,3,2]dioxaborolan-2-uide | ChEBI |
| AI-2 | KEGG COMPOUND |
| Autoinducer 2 | KEGG COMPOUND |
| Citations |
|---|