EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
CHEBI:4055 - cytisine
| Formula | C11H14N2O |
| Net Charge | 0 |
| Average Mass | 190.246 |
| Monoisotopic Mass | 190.11061 |
| SMILES | O=c1cccc2n1C[C@@H]1CNC[C@H]2C1 |
| InChI | InChI=1S/C11H14N2O/c14-11-3-1-2-10-9-4-8(5-12-6-9)7-13(10)11/h1-3,8-9,12H,4-7H2/t8-,9+/m0/s1 |
| InChIKey | ANJTVLIZGCUXLD-DTWKUNHWSA-N |
| Wikipedia |
|---|
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Laburnum anagyroides (ncbitaxon:49828) | - | PubMed (23022271) | |
| Fabaceae (ncbitaxon:3803) | - | PubMed (22978215) |
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| Biological Roles: | plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. phytotoxin Any toxin produced by a plant. nicotinic acetylcholine receptor agonist An agonist that selectively binds to and activates a nicotinic acetylcholine receptor. metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| Application: | nicotinic acetylcholine receptor agonist An agonist that selectively binds to and activates a nicotinic acetylcholine receptor. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| cytisine (CHEBI:4055) has role nicotinic acetylcholine receptor agonist (CHEBI:47958) |
| cytisine (CHEBI:4055) has role phytotoxin (CHEBI:38231) |
| cytisine (CHEBI:4055) has role plant metabolite (CHEBI:76924) |
| cytisine (CHEBI:4055) is a alkaloid (CHEBI:22315) |
| cytisine (CHEBI:4055) is a bridged compound (CHEBI:35990) |
| cytisine (CHEBI:4055) is a lactam (CHEBI:24995) |
| cytisine (CHEBI:4055) is a organic heterotricyclic compound (CHEBI:26979) |
| cytisine (CHEBI:4055) is a secondary amino compound (CHEBI:50995) |
| IUPAC Name |
|---|
| (1R,5S)-1,2,3,4,5,6-hexahydro-8H-1,5-methanopyrido[1,2-a][1,5]diazocin-8-one |
| Synonyms | Source |
|---|---|
| sophorin | ChemIDplus |
| baptitoxin | ChemIDplus |
| laburnin | ChemIDplus |
| sophorine | ChemIDplus |
| baptitoxine | ChemIDplus |
| (−)-cytisine | ChEBI |
| Citations |
|---|