EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C11H14N2O |
| Net Charge | 0 |
| Average Mass | 190.246 |
| Monoisotopic Mass | 190.11061 |
| SMILES | O=c1cccc2n1C[C@@H]1CNC[C@H]2C1 |
| InChI | InChI=1S/C11H14N2O/c14-11-3-1-2-10-9-4-8(5-12-6-9)7-13(10)11/h1-3,8-9,12H,4-7H2/t8-,9+/m0/s1 |
| InChIKey | ANJTVLIZGCUXLD-DTWKUNHWSA-N |
| Wikipedia |
|---|
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Fabaceae (ncbitaxon:3803) | - | PubMed (22978215) | |
| Laburnum anagyroides (ncbitaxon:49828) | - | PubMed (23022271) |
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| Biological Roles: | phytotoxin Any toxin produced by a plant. nicotinic acetylcholine receptor agonist An agonist that selectively binds to and activates a nicotinic acetylcholine receptor. plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| Application: | nicotinic acetylcholine receptor agonist An agonist that selectively binds to and activates a nicotinic acetylcholine receptor. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| cytisine (CHEBI:4055) has role nicotinic acetylcholine receptor agonist (CHEBI:47958) |
| cytisine (CHEBI:4055) has role phytotoxin (CHEBI:38231) |
| cytisine (CHEBI:4055) has role plant metabolite (CHEBI:76924) |
| cytisine (CHEBI:4055) is a alkaloid (CHEBI:22315) |
| cytisine (CHEBI:4055) is a bridged compound (CHEBI:35990) |
| cytisine (CHEBI:4055) is a lactam (CHEBI:24995) |
| cytisine (CHEBI:4055) is a organic heterotricyclic compound (CHEBI:26979) |
| cytisine (CHEBI:4055) is a secondary amino compound (CHEBI:50995) |
| IUPAC Name |
|---|
| (1R,5S)-1,2,3,4,5,6-hexahydro-8H-1,5-methanopyrido[1,2-a][1,5]diazocin-8-one |
| Synonyms | Source |
|---|---|
| baptitoxin | ChemIDplus |
| baptitoxine | ChemIDplus |
| (−)-cytisine | ChEBI |
| laburnin | ChemIDplus |
| sophorin | ChemIDplus |
| sophorine | ChemIDplus |
| Citations |
|---|