EMBL-EBI | Chemical Biology Resources | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C8H16N4O3 |
| Net Charge | 0 |
| Average Mass | 216.241 |
| Monoisotopic Mass | 216.12224 |
| SMILES | CC(=O)N[C@@H](CCCNC(=N)N)C(=O)O |
| InChI | InChI=1S/C8H16N4O3/c1-5(13)12-6(7(14)15)3-2-4-11-8(9)10/h6H,2-4H2,1H3,(H,12,13)(H,14,15)(H4,9,10,11)/t6-/m0/s1 |
| InChIKey | SNEIUMQYRCDYCH-LURJTMIESA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Mus musculus (ncbitaxon:10090) | |||
| - | MetaboLights (MTBLS125) | ||
| - | MetaboLights (MTBLS88) | ||
| - | DOI (10.1371/journal.pone.0115359) | ||
| - | MetaboLights (MTBLS87) |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| Biological Role: | human metabolite Any mammalian metabolite produced during a metabolic reaction in humans (Homo sapiens). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Nα-acetyl-L-arginine (CHEBI:40521) has role human metabolite (CHEBI:77746) |
| Nα-acetyl-L-arginine (CHEBI:40521) is a N-acetyl-L-amino acid (CHEBI:21545) |
| Nα-acetyl-L-arginine (CHEBI:40521) is conjugate acid of Nα-acetyl-L-argininate (CHEBI:61889) |
| Incoming Relation(s) |
| Nα-acetyl-L-argininate (CHEBI:61889) is conjugate base of Nα-acetyl-L-arginine (CHEBI:40521) |
| Nα-acetyl-L-argininyl group (CHEBI:61890) is substituent group from Nα-acetyl-L-arginine (CHEBI:40521) |
| Synonyms | Source |
|---|---|
| N-Ac-L-Arg-OH | ChEBI |
| N2-acetyl-L-arginine | ChEBI |
| N-Acetyl-L-arginine | ChemIDplus |
| Citations |
|---|