EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C21H21N |
| Net Charge | 0 |
| Average Mass | 287.406 |
| Monoisotopic Mass | 287.16740 |
| SMILES | CN1CCC(=C2c3ccccc3C=Cc3ccccc32)CC1 |
| InChI | InChI=1S/C21H21N/c1-22-14-12-18(13-15-22)21-19-8-4-2-6-16(19)10-11-17-7-3-5-9-20(17)21/h2-11H,12-15H2,1H3 |
| InChIKey | JJCFRYNCJDLXIK-UHFFFAOYSA-N |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| Biological Roles: | H1-receptor antagonist H1-receptor antagonists are the drugs that selectively bind to but do not activate histamine H1 receptors, thereby blocking the actions of endogenous histamine. serotonergic antagonist Drugs that bind to but do not activate serotonin receptors, thereby blocking the actions of serotonin or serotonergic agonists. |
| Applications: | gastrointestinal drug A drug used for its effects on the gastrointestinal system, e.g. controlling gastric acidity, regulating gastrointestinal motility and water flow, and improving digestion. antipruritic drug A drug, usually applied topically, that relieves pruritus (itching). H1-receptor antagonist H1-receptor antagonists are the drugs that selectively bind to but do not activate histamine H1 receptors, thereby blocking the actions of endogenous histamine. serotonergic antagonist Drugs that bind to but do not activate serotonin receptors, thereby blocking the actions of serotonin or serotonergic agonists. anti-allergic agent A drug used to treat allergic reactions. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| cyproheptadine (CHEBI:4046) has role anti-allergic agent (CHEBI:50857) |
| cyproheptadine (CHEBI:4046) has role antipruritic drug (CHEBI:59683) |
| cyproheptadine (CHEBI:4046) has role gastrointestinal drug (CHEBI:55324) |
| cyproheptadine (CHEBI:4046) has role H1-receptor antagonist (CHEBI:37955) |
| cyproheptadine (CHEBI:4046) has role serotonergic antagonist (CHEBI:48279) |
| cyproheptadine (CHEBI:4046) is a piperidines (CHEBI:26151) |
| cyproheptadine (CHEBI:4046) is a tertiary amine (CHEBI:32876) |
| Incoming Relation(s) |
| cyproheptadine hydrochloride (anhydrous) (CHEBI:59695) has part cyproheptadine (CHEBI:4046) |
| IUPAC Names |
|---|
| 4-(5H-dibenzo[a,d]cyclohepten-5-ylidene)-1-methylpiperidine |
| 4-(5H-dibenzo[a,d][7]annulen-5-ylidene)-1-methylpiperidine |
| INNs | Source |
|---|---|
| cyproheptadinum | ChemIDplus |
| ciproheptadina | ChemIDplus |
| cyproheptadine | ChemIDplus |
| Synonyms | Source |
|---|---|
| Cyproheptadine | KEGG COMPOUND |
| 4-Dibenzo[a,d]cyclohepten-5-ylidene-1-methyl-piperidine | ChEMBL |
| CYPROHEPTADINE | ChEMBL |
| cyproheptadine | ChEMBL |
| 1-methyl-4-(5-dibenzo(a,e)cycloheptatrienylidene)piperidine | ChemIDplus |
| 1-Methyl-4-(5H-dibenzo(a,d)cycloheptenylidene)piperidine | ChemIDplus |
| Citations |
|---|