EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C14H15N3 |
| Net Charge | 0 |
| Average Mass | 225.295 |
| Monoisotopic Mass | 225.12660 |
| SMILES | Cc1cc(C2CC2)nc(Nc2ccccc2)n1 |
| InChI | InChI=1S/C14H15N3/c1-10-9-13(11-7-8-11)17-14(15-10)16-12-5-3-2-4-6-12/h2-6,9,11H,7-8H2,1H3,(H,15,16,17) |
| InChIKey | HAORKNGNJCEJBX-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Chemical Roles: | environmental contaminant Any minor or unwanted substance introduced into the environment that can have undesired effects. Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| Biological Roles: | antifungal agrochemical Any substance used in acriculture, horticulture, forestry, etc. for its fungicidal properties. aryl hydrocarbon receptor agonist An agonist that binds to and activates aryl hydrocarbon receptors (AhRs). xenobiotic A xenobiotic (Greek, xenos "foreign"; bios "life") is a compound that is foreign to a living organism. Principal xenobiotics include: drugs, carcinogens and various compounds that have been introduced into the environment by artificial means. fungicide A substance used to destroy fungal pests. antifungal agent An antimicrobial agent that destroys fungi by suppressing their ability to grow or reproduce. antifungal agent An antimicrobial agent that destroys fungi by suppressing their ability to grow or reproduce. |
| Applications: | antifungal agrochemical Any substance used in acriculture, horticulture, forestry, etc. for its fungicidal properties. fungicide A substance used to destroy fungal pests. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| cyprodinil (CHEBI:4045) has role antifungal agrochemical (CHEBI:86328) |
| cyprodinil (CHEBI:4045) has role aryl hydrocarbon receptor agonist (CHEBI:72768) |
| cyprodinil (CHEBI:4045) has role environmental contaminant (CHEBI:78298) |
| cyprodinil (CHEBI:4045) has role xenobiotic (CHEBI:35703) |
| cyprodinil (CHEBI:4045) is a aminopyrimidine (CHEBI:38338) |
| cyprodinil (CHEBI:4045) is a anilinopyrimidine fungicide (CHEBI:87208) |
| cyprodinil (CHEBI:4045) is a cyclopropanes (CHEBI:51454) |
| cyprodinil (CHEBI:4045) is a secondary amino compound (CHEBI:50995) |
| IUPAC Name |
|---|
| 4-cyclopropyl-6-methyl-N-phenylpyrimidin-2-amine |
| Synonyms | Source |
|---|---|
| 2-Anilino-4-cyclopropyl-6-methylpyrimidine | HMDB |
| 4-Cyclopropyl-6-methyl-N-phenyl-2-pyrimidinamine | HMDB |
| HSDB 7019 | ChemIDplus |
| Manual Xrefs | Databases |
|---|---|
| 199 | PPDB |
| C10914 | KEGG COMPOUND |
| cyprodinil | Alan Wood's Pesticides |
| EP1023838 | Patent |
| HMDB0034853 | HMDB |
| US2011021580 | Patent |
| Registry Numbers | Sources |
|---|---|
| Reaxys:7813601 | Reaxys |
| CAS:121552-61-2 | NIST Chemistry WebBook |
| CAS:121552-61-2 | KEGG COMPOUND |
| CAS:121552-61-2 | ChemIDplus |
| Citations |
|---|