EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C18H34OSn |
| Net Charge | 0 |
| Average Mass | 385.180 |
| Monoisotopic Mass | 386.16316 |
| SMILES | [OH][Sn]([CH]1CCCCC1)([CH]1CCCCC1)[CH]1CCCCC1 |
| InChI | InChI=1S/3C6H11.H2O.Sn/c3*1-2-4-6-5-3-1;;/h3*1H,2-6H2;1H2;/q;;;;+1/p-1 |
| InChIKey | WCMMILVIRZAPLE-UHFFFAOYSA-M |
| Roles Classification |
|---|
| Application: | acaricide A substance used to destroy pests of the subclass Acari (mites and ticks). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| cyhexatin (CHEBI:4036) is a organotin acaricide (CHEBI:39292) |
| IUPAC Name |
|---|
| tricyclohexylstannanol |
| Synonyms | Source |
|---|---|
| Cyhexatin | KEGG COMPOUND |
| tricyclohexyltin hydroxide | ChemIDplus |
| hydroxytricyclohexylstannane | ChemIDplus |
| tricyclohexylhydroxystannane | ChemIDplus |
| tricyclohexylhydroxytin | ChemIDplus |
| tricyclohexylstannium hydroxide | ChemIDplus |
| Registry Numbers | Sources |
|---|---|
| Beilstein:6099492 | Beilstein |
| Gmelin:31094 | Gmelin |
| CAS:13121-70-5 | KEGG COMPOUND |
| CAS:13121-70-5 | ChemIDplus |