EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C17H15N5O2 |
| Net Charge | 0 |
| Average Mass | 321.340 |
| Monoisotopic Mass | 321.12257 |
| SMILES | NC(=O)c1ccccc1Nc1ccnc(Nc2cccc(O)c2)n1 |
| InChI | InChI=1S/C17H15N5O2/c18-16(24)13-6-1-2-7-14(13)21-15-8-9-19-17(22-15)20-11-4-3-5-12(23)10-11/h1-10,23H,(H2,18,24)(H2,19,20,21,22) |
| InChIKey | QHPKKGUGRGRSGA-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| Biological Role: | protein kinase inhibitor An EC 2.7.* (P-containing group transferase) inhibitor that interferes with the action of protein kinases. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 2-({2-[(3-hydroxyphenyl)amino]pyrimidin-4-yl}amino)benzamide (CHEBI:40332) has role protein kinase inhibitor (CHEBI:37699) |
| 2-({2-[(3-hydroxyphenyl)amino]pyrimidin-4-yl}amino)benzamide (CHEBI:40332) is a aminopyrimidine (CHEBI:38338) |
| 2-({2-[(3-hydroxyphenyl)amino]pyrimidin-4-yl}amino)benzamide (CHEBI:40332) is a benzamides (CHEBI:22702) |
| IUPAC Name |
|---|
| 2-({2-[(3-hydroxyphenyl)amino]pyrimidin-4-yl}amino)benzamide |
| Synonyms | Source |
|---|---|
| 2-({2-[(3-HYDROXYPHENYL)AMINO]PYRIMIDIN-4-YL}AMINO)BENZAMIDE | PDBeChem |
| 4-(2-carbamoylanilino)-2-(3-hydroxyanilino)pyrimidine | ChEBI |