EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C33H38N6O10 |
| Net Charge | 0 |
| Average Mass | 678.699 |
| Monoisotopic Mass | 678.26494 |
| SMILES | C/C=C\NC(=O)[C@H]1NC(=O)[C@H](CC(N)=O)NC(=O)[C@@H](NC(=O)C(=O)[C@@H](C)CC)Cc2ccc(O)c(c2)-c2cccc3c2NC(=O)[C@@]3(O)[C@@H]1O |
| InChI | InChI=1S/C33H38N6O10/c1-4-11-35-30(46)25-27(43)33(49)19-8-6-7-17(24(19)39-32(33)48)18-12-16(9-10-22(18)40)13-20(37-31(47)26(42)15(3)5-2)28(44)36-21(14-23(34)41)29(45)38-25/h4,6-12,15,20-21,25,27,40,43,49H,5,13-14H2,1-3H3,(H2,34,41)(H,35,46)(H,36,44)(H,37,47)(H,38,45)(H,39,48)/b11-4-/t15-,20-,21-,25-,27+,33-/m0/s1 |
| InChIKey | ZIAXNZCTODBCKW-BOYGTWLISA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Apiospora montagnei (ncbitaxon:255776) | - | PubMed (10814045) | Strain: TC 1093 |
| Roles Classification |
|---|
| Biological Roles: | bacterial metabolite Any prokaryotic metabolite produced during a metabolic reaction in bacteria. fungal metabolite Any eukaryotic metabolite produced during a metabolic reaction in fungi, the kingdom that includes microorganisms such as the yeasts and moulds. antimicrobial agent A substance that kills or slows the growth of microorganisms, including bacteria, viruses, fungi and protozoans. |
| Applications: | antineoplastic agent A substance that inhibits or prevents the proliferation of neoplasms. proteasome inhibitor A drug that blocks the action of proteasomes, cellular complexes that break down proteins. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| TMC-95A (CHEBI:40322) has role antimicrobial agent (CHEBI:33281) |
| TMC-95A (CHEBI:40322) has role antineoplastic agent (CHEBI:35610) |
| TMC-95A (CHEBI:40322) has role bacterial metabolite (CHEBI:76969) |
| TMC-95A (CHEBI:40322) has role fungal metabolite (CHEBI:76946) |
| TMC-95A (CHEBI:40322) has role proteasome inhibitor (CHEBI:52726) |
| TMC-95A (CHEBI:40322) is a indoles (CHEBI:24828) |
| TMC-95A (CHEBI:40322) is a lactam (CHEBI:24995) |
| TMC-95A (CHEBI:40322) is a macrocycle (CHEBI:51026) |
| TMC-95A (CHEBI:40322) is a phenols (CHEBI:33853) |
| TMC-95A (CHEBI:40322) is a secondary alcohol (CHEBI:35681) |
| TMC-95A (CHEBI:40322) is a tertiary alcohol (CHEBI:26878) |
| IUPAC Name |
|---|
| (10S,11R,12S,15S,18S)-15-(2-amino-2-oxoethyl)-10,11,23-trihydroxy-18-{[(3S)-3-methyl-2-oxopentanoyl]amino}-9,14,17-trioxo-N-[(1Z)-prop-1-en-1-yl]-8,13,16-triazatetracyclo[18.3.1.02,7.06,10]tetracosa-1(24),2,4,6,20,22-hexaene-12-carboxamide |
| Registry Numbers | Sources |
|---|---|
| Reaxys:9110474 | Reaxys |
| Citations |
|---|