EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C27H48N2O |
| Net Charge | 0 |
| Average Mass | 416.694 |
| Monoisotopic Mass | 416.37666 |
| SMILES | [H][C@]1([C@H](C)N(C)C)[C@H](O)C[C@@]2(C)[C@]3([H])CC[C@@]4([H])C(C)(C)[C@@H](NC)CC[C@@]45C[C@@]35CC[C@]12C |
| InChI | InChI=1S/C27H48N2O/c1-17(29(7)8)22-18(30)15-25(5)20-10-9-19-23(2,3)21(28-6)11-12-26(19)16-27(20,26)14-13-24(22,25)4/h17-22,28,30H,9-16H2,1-8H3/t17-,18+,19-,20-,21-,22-,24+,25-,26+,27-/m0/s1 |
| InChIKey | IDOHCEDWHOEHNL-ZUDQDPCPSA-N |
| Roles Classification |
|---|
| Biological Role: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Cyclovirobuxine C (CHEBI:4032) is a steroid alkaloid (CHEBI:26767) |
| Synonym | Source |
|---|---|
| Cyclovirobuxine C | KEGG COMPOUND |