EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C62H111N11O12 |
| Net Charge | 0 |
| Average Mass | 1202.635 |
| Monoisotopic Mass | 1201.84137 |
| SMILES | C/C=C/C[C@@H](C)[C@@H](O)[C@H]1C(=O)N[C@@H](CC)C(=O)N(C)CC(=O)N(C)[C@@H](CC(C)C)C(=O)N[C@@H](C(C)C)C(=O)N(C)[C@@H](CC(C)C)C(=O)N[C@@H](C)C(=O)N[C@H](C)C(=O)N(C)[C@@H](CC(C)C)C(=O)N(C)[C@@H](CC(C)C)C(=O)N(C)[C@@H](C(C)C)C(=O)N1C |
| InChI | InChI=1S/C62H111N11O12/c1-25-27-28-40(15)52(75)51-56(79)65-43(26-2)58(81)67(18)33-48(74)68(19)44(29-34(3)4)55(78)66-49(38(11)12)61(84)69(20)45(30-35(5)6)54(77)63-41(16)53(76)64-42(17)57(80)70(21)46(31-36(7)8)59(82)71(22)47(32-37(9)10)60(83)72(23)50(39(13)14)62(85)73(51)24/h25,27,34-47,49-52,75H,26,28-33H2,1-24H3,(H,63,77)(H,64,76)(H,65,79)(H,66,78)/b27-25+/t40-,41+,42-,43+,44+,45+,46+,47+,49+,50+,51+,52-/m1/s1 |
| InChIKey | PMATZTZNYRCHOR-CGLBZJNRSA-N |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| Biological Roles: | immunosuppressive agent An agent that suppresses immune function by one of several mechanisms of action. Classical cytotoxic immunosuppressants act by inhibiting DNA synthesis. Others may act through activation of T-cells or by inhibiting the activation of helper cells. In addition, an immunosuppressive agent is a role played by a compound which is exhibited by a capability to diminish the extent and/or voracity of an immune response. metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. EC 3.1.3.16 (phosphoprotein phosphatase) inhibitor Any EC 3.1.3.* (phosphoric monoester hydrolase) inhibitor that interferes with the action of phosphoprotein phosphatase (EC 3.1.3.16). carcinogenic agent A role played by a chemical compound which is known to induce a process of carcinogenesis by corrupting normal cellular pathways, leading to the acquistion of tumoral capabilities. anticoronaviral agent Any antiviral agent which inhibits the activity of coronaviruses. antifungal agent An antimicrobial agent that destroys fungi by suppressing their ability to grow or reproduce. |
| Applications: | geroprotector Any compound that supports healthy aging, slows the biological aging process, or extends lifespan. antirheumatic drug A drug used to treat rheumatoid arthritis. immunosuppressive agent An agent that suppresses immune function by one of several mechanisms of action. Classical cytotoxic immunosuppressants act by inhibiting DNA synthesis. Others may act through activation of T-cells or by inhibiting the activation of helper cells. In addition, an immunosuppressive agent is a role played by a compound which is exhibited by a capability to diminish the extent and/or voracity of an immune response. anti-asthmatic drug A drug used to treat asthma. dermatologic drug A drug used to treat or prevent skin disorders or for the routine care of skin. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| cyclosporin A (CHEBI:4031) has role anti-asthmatic drug (CHEBI:49167) |
| cyclosporin A (CHEBI:4031) has role anticoronaviral agent (CHEBI:149553) |
| cyclosporin A (CHEBI:4031) has role antifungal agent (CHEBI:35718) |
| cyclosporin A (CHEBI:4031) has role antirheumatic drug (CHEBI:35842) |
| cyclosporin A (CHEBI:4031) has role carcinogenic agent (CHEBI:50903) |
| cyclosporin A (CHEBI:4031) has role dermatologic drug (CHEBI:50177) |
| cyclosporin A (CHEBI:4031) has role EC 3.1.3.16 (phosphoprotein phosphatase) inhibitor (CHEBI:37153) |
| cyclosporin A (CHEBI:4031) has role geroprotector (CHEBI:176497) |
| cyclosporin A (CHEBI:4031) has role immunosuppressive agent (CHEBI:35705) |
| cyclosporin A (CHEBI:4031) has role metabolite (CHEBI:25212) |
| cyclosporin A (CHEBI:4031) is a homodetic cyclic peptide (CHEBI:24613) |
| Incoming Relation(s) |
| cyclosporin A derivative (CHEBI:140151) has functional parent cyclosporin A (CHEBI:4031) |
| IUPAC Name |
|---|
| 30-ethyl-33-[(4E)-1-hydroxy-2-methylhex-4-en-1-yl]-1,4,7,10,12,15,19,25,28-nonamethyl-6,9,18,24-tetrakis(2-methylpropyl)-3,21-bis(propan-2-yl)-1,4,7,10,13,16,19,22,25,28,31-undecaazacyclotritriacontane-2,5,8,11,14,17,20,23,26,29,32-undecone |
| INNs | Source |
|---|---|
| ciclosporina | ChemIDplus |
| ciclosporine | ChemIDplus |
| ciclosporinum | ChemIDplus |
| ciclosporin | KEGG DRUG |
| Synonyms | Source |
|---|---|
| Cyclosporin A | KEGG COMPOUND |
| Ciclosporin | KEGG COMPOUND |
| 30-ethyl-33-[(4E)-1-hydroxy-2-methylhex-4-en-1-yl]-6,9,18,24-tetraisobutyl-3,21-diisopropyl-1,4,7,10,12,15,19,25,28-nonamethyl-1,4,7,10,13,16,19,22,25,28,31-undecaazacyclotritriacontane-2,5,8,11,14,17,20,23,26,29,32-undecone | ChEBI |
| Cyclo(L-alanyl-D-alanyl-N-methyl-L-leucyl-N-methyl-L-leucyl-N-methyl-L-valyl-((3R,4R,6E)-6,7-didehydro-3-hydroxy-N,4-dimethyl-L-2-aminooctanoyl)-L-2-aminobutanoyl-N-methylglycyl-N-methyl-L-leucyl-L-valyl-N-methylleucyl) | ChemIDplus |
| 1,11-cyclo[L-alanyl-D-alanyl-N-methyl-L-leucyl-N-methyl-L-leucyl-N-methyl-L-valyl-(E)-(2S,3R,4R)-2-amino-3-hydroxy-N,4-dimethyloct-6-enoyl-L-2-aminobutanoyl-N-methylglycyl-N-methyl-L-leucyl-L-valyl-N-methyl-L-leucine] | JCBN |
| Cyclosporine | ChemIDplus |
| Brand Names | Source |
|---|---|
| Gengraf | DrugBank |
| Neoral | DrugBank |
| Sandimmune | DrugBank |
| UniProt Name | Source |
|---|---|
| cyclosporin A | UniProt |
| Manual Xrefs | Databases |
|---|---|
| C05086 | KEGG COMPOUND |
| D00184 | KEGG DRUG |
| DB00091 | DrugBank |
| US4117118 | Patent |
| Ciclosporin | Wikipedia |
| C00001517 | KNApSAcK |
| LSM-1703 | LINCS |
| 760 | DrugCentral |
| 1765 | VSDB |
| 4447449 | ChemSpider |
| CPD-20532 | MetaCyc |
| LMPK14000003 | LIPID MAPS |
| HMDB0250682 | HMDB |
| Registry Numbers | Sources |
|---|---|
| Reaxys:3647785 | Reaxys |
| CAS:59865-13-3 | KEGG COMPOUND |
| CAS:59865-13-3 | ChemIDplus |
| Citations |
|---|