EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C27H48N2 |
| Net Charge | 0 |
| Average Mass | 400.695 |
| Monoisotopic Mass | 400.38175 |
| SMILES | [H][C@@]12CC[C@@]3([H])C(C)(C)[C@@H](NC)CC[C@@]34C[C@@]14CC[C@@]1(C)[C@@]2(C)CC[C@]1([H])[C@H](C)N(C)C |
| InChI | InChI=1S/C27H48N2/c1-18(29(7)8)19-11-13-25(5)21-10-9-20-23(2,3)22(28-6)12-14-26(20)17-27(21,26)16-15-24(19,25)4/h18-22,28H,9-17H2,1-8H3/t18-,19+,20-,21-,22-,24+,25-,26+,27-/m0/s1 |
| InChIKey | PLKVWYPBRRRIQG-QGSMACLHSA-N |
| Roles Classification |
|---|
| Biological Role: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Cycloprotobuxine C (CHEBI:4029) is a steroid alkaloid (CHEBI:26767) |
| Synonym | Source |
|---|---|
| Cycloprotobuxine C | KEGG COMPOUND |