EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C27H33N9O16P2 |
| Net Charge | 0 |
| Average Mass | 801.556 |
| Monoisotopic Mass | 801.15205 |
| SMILES | Cc1cc2c(nc3c(=O)nc(=O)nc-3n2C[C@H](O)[C@H](O)[C@H](O)COP(=O)(O)OP(=O)(O)OC[C@H]2O[C@@H](n3cnc4c(N)ncnc43)[C@H](O)[C@@H]2O)c(O)c1C |
| InChI | InChI=1S/C27H33N9O16P2/c1-9-3-11-15(18(39)10(9)2)32-17-24(33-27(44)34-25(17)43)35(11)4-12(37)19(40)13(38)5-49-53(45,46)52-54(47,48)50-6-14-20(41)21(42)26(51-14)36-8-31-16-22(28)29-7-30-23(16)36/h3,7-8,12-14,19-21,26,37-42H,4-6H2,1-2H3,(H,45,46)(H,47,48)(H2,28,29,30)(H,34,43,44)/t12-,13+,14+,19-,20+,21+,26+/m0/s1 |
| InChIKey | BJSUUWFQAMLNKU-OKXKTURISA-N |
| Roles Classification |
|---|
| Biological Roles: | cofactor An organic molecule or ion (usually a metal ion) that is required by an enzyme for its activity. It may be attached either loosely (coenzyme) or tightly (prosthetic group). cofactor An organic molecule or ion (usually a metal ion) that is required by an enzyme for its activity. It may be attached either loosely (coenzyme) or tightly (prosthetic group). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 6-hydroxy-FAD (CHEBI:40260) has role cofactor (CHEBI:23357) |
| 6-hydroxy-FAD (CHEBI:40260) is a flavin adenine dinucleotide (CHEBI:24040) |
| 6-hydroxy-FAD (CHEBI:40260) is conjugate acid of 6-hydroxy-FAD(3−) (CHEBI:60470) |
| Incoming Relation(s) |
| 6-hydroxy-FAD(3−) (CHEBI:60470) is conjugate base of 6-hydroxy-FAD (CHEBI:40260) |
| IUPAC Name |
|---|
| adenosine 5'-(3-{D-ribo-5-[6-hydroxy-7,8-dimethyl-2,4-dioxo-3,4-dihydrobenzo[g]pteridin-10(2H)-yl]-2,3,4-trihydroxypentyl} dihydrogen diphosphate) |
| Synonyms | Source |
|---|---|
| [(2R,3S,4R,5R)-5-(6-amino-9H-purin-9-yl)-3,4-dihydroxytetrahydrofuran-2-yl]methyl (2R,3S,4S)-2,3,4-trihydroxy-5-(6-hydroxy-7,8-dimethyl-2,4-dioxo-3,4-dihydrobenzo[g]pteridin-10(2H)-yl)pentyl dihydrogen diphosphate | IUPAC |
| 6-HO-FAD | ChEBI |
| 6-hydroxy-fad | ChemIDplus |
| 6-hydroxyflavin-adenine dinucleotide | ChEBI |
| 6-HYDROXY-FLAVIN-ADENINE DINUCLEOTIDE | PDBeChem |
| 6-hydroxyflavine-adenine dinucleotide | ChEBI |
| Registry Numbers | Sources |
|---|---|
| CAS:52301-43-6 | ChemIDplus |