EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
CHEBI:4021 - Cyclopamine
| Formula | C27H41NO2 |
| Net Charge | 0 |
| Average Mass | 411.630 |
| Monoisotopic Mass | 411.31373 |
| SMILES | [H][C@]12CC3=C(C)[C@]4(CC[C@@]3([H])[C@]1([H])CC=C1C[C@@H](O)CC[C@@]12C)O[C@]1([H])C[C@H](C)CN[C@@]1([H])[C@H]4C |
| InChI | InChI=1S/C27H41NO2/c1-15-11-24-25(28-14-15)17(3)27(30-24)10-8-20-21-6-5-18-12-19(29)7-9-26(18,4)23(21)13-22(20)16(27)2/h5,15,17,19-21,23-25,28-29H,6-14H2,1-4H3/t15-,17+,19-,20-,21-,23-,24+,25-,26-,27-/m0/s1 |
| InChIKey | QASFUMOKHFSJGL-LAFRSMQTSA-N |
| Roles Classification |
|---|
| Biological Role: | glioma-associated oncogene inhibitor An inhibitor of any of the glioma-associated oncogene (GLI) proteins. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Cyclopamine (CHEBI:4021) has role glioma-associated oncogene inhibitor (CHEBI:140922) |
| Cyclopamine (CHEBI:4021) is a piperidines (CHEBI:26151) |
| Synonym | Source |
|---|---|
| Cyclopamine | KEGG COMPOUND |