EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C9H11FN2O6 |
| Net Charge | 0 |
| Average Mass | 262.193 |
| Monoisotopic Mass | 262.06011 |
| SMILES | O=c1nc(=O)n([C@@H]2O[C@H](CO)[C@@H](O)[C@H]2O)cc1F |
| InChI | InChI=1S/C9H11FN2O6/c10-3-1-12(9(17)11-7(3)16)8-6(15)5(14)4(2-13)18-8/h1,4-6,8,13-15H,2H2,(H,11,16,17)/t4-,5-,6-,8-/m1/s1 |
| InChIKey | FHIDNBAQOFJWCA-UAKXSSHOSA-N |
| Roles Classification |
|---|
| Biological Role: | mutagen An agent that increases the frequency of mutations above the normal background level, usually by interacting directly with DNA and causing it damage, including base substitution. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 5-fluorouridine (CHEBI:40154) has role mutagen (CHEBI:25435) |
| 5-fluorouridine (CHEBI:40154) is a organofluorine compound (CHEBI:37143) |
| 5-fluorouridine (CHEBI:40154) is a uridines (CHEBI:27242) |
| Synonyms | Source |
|---|---|
| 5-Fluorouracil 1beta-D-ribofuranoside | DrugBank |
| 5-Fluoro-uridine | DrugBank |
| 5-FLUOROURIDINE | PDBeChem |
| UniProt Name | Source |
|---|---|
| 5-fluorouridine | UniProt |
| Registry Numbers | Sources |
|---|---|
| Beilstein:33662 | Beilstein |
| Reaxys:33662 | Reaxys |
| Gmelin:466575 | Gmelin |
| CAS:316-46-1 | KEGG COMPOUND |
| CAS:316-46-1 | ChemIDplus |
| CAS:316-46-1 | KEGG DRUG |
| Citations |
|---|