EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
CHEBI:40114 - 4-(2-thienyl)butyric acid
| Formula | C8H10O2S |
| Net Charge | 0 |
| Average Mass | 170.233 |
| Monoisotopic Mass | 170.04015 |
| SMILES | O=C(O)CCCc1cccs1 |
| InChI | InChI=1S/C8H10O2S/c9-8(10)5-1-3-7-4-2-6-11-7/h2,4,6H,1,3,5H2,(H,9,10) |
| InChIKey | VYTXLSQVYGNWLV-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| Biological Role: | hapten Any substance capable of eliciting an immune response only when attached to a large carrier such as a protein. Examples include dinitrophenols; oligosaccharides; peptides; and heavy metals. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 4-(2-thienyl)butyric acid (CHEBI:40114) has functional parent butyric acid (CHEBI:30772) |
| 4-(2-thienyl)butyric acid (CHEBI:40114) has role hapten (CHEBI:59174) |
| 4-(2-thienyl)butyric acid (CHEBI:40114) is a monocarboxylic acid (CHEBI:25384) |
| 4-(2-thienyl)butyric acid (CHEBI:40114) is a thiophenes (CHEBI:26961) |
| IUPAC Name |
|---|
| 4-(2-thienyl)butanoic acid |
| Synonyms | Source |
|---|---|
| 2-Thiophenebutanoic acid | NIST Chemistry WebBook |
| 2-Thiophenebutyric acid | NIST Chemistry WebBook |
| 4-thiophen-2-ylbutanoic acid | PDBeChem |
| γ-(α-thienyl)butyricacid | NIST Chemistry WebBook |
| Citations |
|---|