EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C25H35N3O6S |
| Net Charge | 0 |
| Average Mass | 505.637 |
| Monoisotopic Mass | 505.22466 |
| SMILES | CC(C)CN(C[C@@H](O)[C@H](Cc1ccccc1)NC(=O)O[C@H]1CCOC1)S(=O)(=O)c1ccc(N)cc1 |
| InChI | InChI=1S/C25H35N3O6S/c1-18(2)15-28(35(31,32)22-10-8-20(26)9-11-22)16-24(29)23(14-19-6-4-3-5-7-19)27-25(30)34-21-12-13-33-17-21/h3-11,18,21,23-24,29H,12-17,26H2,1-2H3,(H,27,30)/t21-,23-,24+/m0/s1 |
| InChIKey | YMARZQAQMVYCKC-OEMFJLHTSA-N |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Biological Roles: | antiviral drug A substance used in the prophylaxis or therapy of virus diseases. HIV protease inhibitor An inhibitor of HIV protease, an enzyme required for production of proteins needed for viral assembly. |
| Application: | antiviral drug A substance used in the prophylaxis or therapy of virus diseases. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| amprenavir (CHEBI:40050) has role antiviral drug (CHEBI:36044) |
| amprenavir (CHEBI:40050) has role HIV protease inhibitor (CHEBI:35660) |
| amprenavir (CHEBI:40050) is a carbamate ester (CHEBI:23003) |
| amprenavir (CHEBI:40050) is a sulfonamide (CHEBI:35358) |
| amprenavir (CHEBI:40050) is a tetrahydrofuryl ester (CHEBI:47020) |
| IUPAC Name |
|---|
| (3S)-tetrahydrofuran-3-yl [(1S,2R)-3-{[(4-aminophenyl)sulfonyl](2-methylpropyl)amino}-1-benzyl-2-hydroxypropyl]carbamate |
| Synonyms | Source |
|---|---|
| (3S)-Tetrahydro-3-furanyl ((1S,2R)-3-(((4-aminophenyl)sulfonyl)(2-methylpropyl)amino)-2-hydroxy-1-(phenylmethyl)propyl)carbamate | ChemIDplus |
| Agenerase | ChemIDplus |
| Amprenavir | KEGG COMPOUND |
| Amprenavir | KEGG DRUG |
| Manual Xrefs | Databases |
|---|---|
| 200 | DrugCentral |
| Amprenavir | Wikipedia |
| C08086 | KEGG COMPOUND |
| D00894 | KEGG DRUG |
| DB00701 | DrugBank |
| Registry Numbers | Sources |
|---|---|
| Beilstein:10126027 | Beilstein |
| CAS:161814-49-9 | KEGG COMPOUND |
| CAS:161814-49-9 | ChemIDplus |