EMBL-EBI | Chemical Biology Resources | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | 2C11H14ClN5.C23H16O6 |
| Net Charge | 0 |
| Average Mass | 891.817 |
| Monoisotopic Mass | 890.28223 |
| SMILES | CC1(C)N=C(N)N=C(N)N1c1ccc(Cl)cc1.CC1(C)N=C(N)N=C(N)N1c1ccc(Cl)cc1.O=C(O)c1cc2ccccc2c(Cc2c(O)c(C(=O)O)cc3ccccc23)c1O |
| InChI | InChI=1S/C23H16O6.2C11H14ClN5/c24-20-16(14-7-3-1-5-12(14)9-18(20)22(26)27)11-17-15-8-4-2-6-13(15)10-19(21(17)25)23(28)29;2*1-11(2)16-9(13)15-10(14)17(11)8-5-3-7(12)4-6-8/h1-10,24-25H,11H2,(H,26,27)(H,28,29);2*3-6H,1-2H3,(H4,13,14,15,16) |
| InChIKey | LUNRMKZYOGNOTR-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Biological Role: | antimalarial A drug used in the treatment of malaria. Antimalarials are usually classified on the basis of their action against Plasmodia at different stages in their life cycle in the human. |
| Application: | antimalarial A drug used in the treatment of malaria. Antimalarials are usually classified on the basis of their action against Plasmodia at different stages in their life cycle in the human. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Cycloguanil pamoate (CHEBI:4003) has role antimalarial (CHEBI:38068) |
| Cycloguanil pamoate (CHEBI:4003) is a polymer (CHEBI:60027) |
| INNs | Source |
|---|---|
| embonate de cycloguanil | WHO MedNet |
| embonato de cicloguanil | WHO MedNet |
| Synonyms | Source |
|---|---|
| Chloroguanide triazine pamoate | ChEMBL |
| CI-501 | ChEMBL |
| CN-14,329-23A | ChEMBL |
| CN-14329-23A | ChEMBL |
| Cycloguanil embonate | ChEMBL |
| Cycloguanil pamoate | KEGG COMPOUND |