EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
CHEBI:40021 - tiratricol
| Formula | C14H9I3O4 |
| Net Charge | 0 |
| Average Mass | 621.934 |
| Monoisotopic Mass | 621.76350 |
| SMILES | O=C(O)Cc1cc(I)c(Oc2ccc(O)c(I)c2)c(I)c1 |
| InChI | InChI=1S/C14H9I3O4/c15-9-6-8(1-2-12(9)18)21-14-10(16)3-7(4-11(14)17)5-13(19)20/h1-4,6,18H,5H2,(H,19,20) |
| InChIKey | UOWZUVNAGUAEQC-UHFFFAOYSA-N |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| Biological Roles: | human metabolite Any mammalian metabolite produced during a metabolic reaction in humans (Homo sapiens). thyroid hormone Any hormone produced by the thyroid gland anti-obesity agent Any substance which is used to reduce or control weight. antiviral agent A substance that destroys or inhibits replication of viruses. EC 1.3.5.2 [dihydroorotate dehydrogenase (quinone)] inhibitor An EC 1.3.5.* (oxidoreductase acting on CH-CH of donor with a quinone or related compound as acceptor) inhibitor that interferes with the action of dihydroorotate dehydrogenase (quinone), EC 1.3.5.2. |
| Application: | nutraceutical A product in capsule, tablet or liquid form that provide essential nutrients, such as a vitamin, an essential mineral, a protein, an herb, or similar nutritional substance. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| tiratricol (CHEBI:40021) has role anti-obesity agent (CHEBI:74518) |
| tiratricol (CHEBI:40021) has role antiviral agent (CHEBI:22587) |
| tiratricol (CHEBI:40021) has role EC 1.3.5.2 [dihydroorotate dehydrogenase (quinone)] inhibitor (CHEBI:77103) |
| tiratricol (CHEBI:40021) has role human metabolite (CHEBI:77746) |
| tiratricol (CHEBI:40021) has role nutraceutical (CHEBI:50733) |
| tiratricol (CHEBI:40021) has role thyroid hormone (CHEBI:60311) |
| tiratricol (CHEBI:40021) is a aromatic ether (CHEBI:35618) |
| tiratricol (CHEBI:40021) is a monocarboxylic acid (CHEBI:25384) |
| tiratricol (CHEBI:40021) is a organoiodine compound (CHEBI:37142) |
| tiratricol (CHEBI:40021) is a phenols (CHEBI:33853) |
| IUPAC Name |
|---|
| [4-(4-hydroxy-3-iodophenoxy)-3,5-diiodophenyl]acetic acid |
| INNs | Source |
|---|---|
| tiratricol | WHO MedNet |
| tiratricol | WHO MedNet |
| tiratricol | WHO MedNet |
| tiratricolum | WHO MedNet |
| Synonyms | Source |
|---|---|
| 2-[4-(4-hydroxy-3-iodophenoxy)-3,5-diiodophenyl]acetic acid | ChEBI |
| 3,3',5-triiodothyroacetic acid | ChEBI |
| 4-(4-hydroxy-3-iodophenoxy)-3,5-diiodobenzeneacetic acid | ChEBI |
| [(4-hydroxy-3-iodo-4-phenoxy)-3,5-diiodophenyl]acetic acid | ChEBI |
| T3A | ChEBI |
| TRIAC | ChEBI |
| Brand Names | Source |
|---|---|
| Emcitate | ChEBI |
| Nidolin | ChEBI |
| Téatrois | ChEBI |
| Tiracana | KEGG DRUG |
| Triax | ChEBI |
| Citations |
|---|