EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
CHEBI:40021 - tiratricol
| Formula | C14H9I3O4 |
| Net Charge | 0 |
| Average Mass | 621.934 |
| Monoisotopic Mass | 621.76350 |
| SMILES | O=C(O)Cc1cc(I)c(Oc2ccc(O)c(I)c2)c(I)c1 |
| InChI | InChI=1S/C14H9I3O4/c15-9-6-8(1-2-12(9)18)21-14-10(16)3-7(4-11(14)17)5-13(19)20/h1-4,6,18H,5H2,(H,19,20) |
| InChIKey | UOWZUVNAGUAEQC-UHFFFAOYSA-N |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| Biological Roles: | antiviral agent A substance that destroys or inhibits replication of viruses. anti-obesity agent Any substance which is used to reduce or control weight. EC 1.3.5.2 [dihydroorotate dehydrogenase (quinone)] inhibitor An EC 1.3.5.* (oxidoreductase acting on CH-CH of donor with a quinone or related compound as acceptor) inhibitor that interferes with the action of dihydroorotate dehydrogenase (quinone), EC 1.3.5.2. thyroid hormone Any hormone produced by the thyroid gland human metabolite Any mammalian metabolite produced during a metabolic reaction in humans (Homo sapiens). |
| Application: | nutraceutical A product in capsule, tablet or liquid form that provide essential nutrients, such as a vitamin, an essential mineral, a protein, an herb, or similar nutritional substance. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| tiratricol (CHEBI:40021) has role anti-obesity agent (CHEBI:74518) |
| tiratricol (CHEBI:40021) has role antiviral agent (CHEBI:22587) |
| tiratricol (CHEBI:40021) has role EC 1.3.5.2 [dihydroorotate dehydrogenase (quinone)] inhibitor (CHEBI:77103) |
| tiratricol (CHEBI:40021) has role human metabolite (CHEBI:77746) |
| tiratricol (CHEBI:40021) has role nutraceutical (CHEBI:50733) |
| tiratricol (CHEBI:40021) has role thyroid hormone (CHEBI:60311) |
| tiratricol (CHEBI:40021) is a aromatic ether (CHEBI:35618) |
| tiratricol (CHEBI:40021) is a monocarboxylic acid (CHEBI:25384) |
| tiratricol (CHEBI:40021) is a organoiodine compound (CHEBI:37142) |
| tiratricol (CHEBI:40021) is a phenols (CHEBI:33853) |
| IUPAC Name |
|---|
| [4-(4-hydroxy-3-iodophenoxy)-3,5-diiodophenyl]acetic acid |
| INNs | Source |
|---|---|
| tiratricolum | WHO MedNet |
| tiratricol | WHO MedNet |
| tiratricol | WHO MedNet |
| tiratricol | WHO MedNet |
| Synonyms | Source |
|---|---|
| 4-(4-hydroxy-3-iodophenoxy)-3,5-diiodobenzeneacetic acid | ChEBI |
| 3,3',5-triiodothyroacetic acid | ChEBI |
| [(4-hydroxy-3-iodo-4-phenoxy)-3,5-diiodophenyl]acetic acid | ChEBI |
| 2-[4-(4-hydroxy-3-iodophenoxy)-3,5-diiodophenyl]acetic acid | ChEBI |
| TRIAC | ChEBI |
| T3A | ChEBI |
| Brand Names | Source |
|---|---|
| Tiracana | KEGG DRUG |
| Nidolin | ChEBI |
| Téatrois | ChEBI |
| Triax | ChEBI |
| Emcitate | ChEBI |
| Citations |
|---|