EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C47H80O18 |
| Net Charge | 0 |
| Average Mass | 933.139 |
| Monoisotopic Mass | 932.53447 |
| SMILES | [H][C@@]12CC[C@]3([H])[C@@]4(CC[C@H](O[C@@H]5OC[C@H](O)[C@H](O)[C@H]5O)[C@]3(C)CO)C[C@@]14CC[C@]1(C)C([C@H](C)CC[C@H](O)C(C)(C)O)[C@@H](O[C@@H]3O[C@H](CO[C@@H]4O[C@@H](C)[C@H](O)[C@@H](O)[C@H]4O)[C@@H](O)[C@H](O)[C@H]3O)C[C@@]21C |
| InChI | InChI=1S/C47H80O18/c1-21(8-11-28(50)42(3,4)59)30-24(63-41-38(58)35(55)33(53)25(64-41)18-61-39-37(57)34(54)31(51)22(2)62-39)16-45(7)27-10-9-26-43(5,20-48)29(65-40-36(56)32(52)23(49)17-60-40)12-13-46(26)19-47(27,46)15-14-44(30,45)6/h21-41,48-59H,8-20H2,1-7H3/t21-,22+,23+,24+,25-,26+,27+,28+,29+,30?,31+,32+,33-,34-,35+,36-,37-,38-,39-,40+,41-,43-,44-,45+,46-,47+/m1/s1 |
| InChIKey | JDYWIMCSAUNOHC-OOLFRTMQSA-N |
| Roles Classification |
|---|
| Biological Role: | allelochemical A class of secondary metabolites developed by many plants to influence the behaviour, growth or survival of herbivores, and thus acting as a defence against herbivory. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Cyclofoetoside B (CHEBI:4002) is a 4β-hydroxymethyl steroid (CHEBI:145945) |
| Cyclofoetoside B (CHEBI:4002) is a cucurbitacin (CHEBI:16219) |
| Cyclofoetoside B (CHEBI:4002) is a glycoside (CHEBI:24400) |
| Synonym | Source |
|---|---|
| Cyclofoetoside B | KEGG COMPOUND |