EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C5H7N3O |
| Net Charge | 0 |
| Average Mass | 125.131 |
| Monoisotopic Mass | 125.05891 |
| SMILES | Cn1c(N)ccnc1=O |
| InChI | InChI=1S/C5H7N3O/c1-8-4(6)2-3-7-5(8)9/h2-3H,6H2,1H3 |
| InChIKey | KOLPWZCZXAMXKS-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| Biological Role: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 3-methylcytosine (CHEBI:39992) has functional parent cytosine (CHEBI:16040) |
| 3-methylcytosine (CHEBI:39992) has role metabolite (CHEBI:25212) |
| 3-methylcytosine (CHEBI:39992) is a aminopyrimidine (CHEBI:38338) |
| 3-methylcytosine (CHEBI:39992) is a methylcytosine (CHEBI:134207) |
| 3-methylcytosine (CHEBI:39992) is a pyrimidone (CHEBI:38337) |
| IUPAC Name |
|---|
| 6-amino-1-methylpyrimidin-2(1H)-one |
| Synonym | Source |
|---|---|
| N3-methylcytosine | ChEBI |
| UniProt Name | Source |
|---|---|
| 3-methylcytosine | UniProt |
| Manual Xrefs | Databases |
|---|---|
| 3MC | PDBeChem |
| DB04103 | DrugBank |
| HMDB0011601 | HMDB |
| Registry Numbers | Sources |
|---|---|
| Reaxys:117790 | Reaxys |
| CAS:4776-08-3 | ChemIDplus |
| Citations |
|---|