EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C25H42N2O |
| Net Charge | 0 |
| Average Mass | 386.624 |
| Monoisotopic Mass | 386.32971 |
| SMILES | [H][C@]1([C@H](C)NC)[C@H](O)C[C@@]2(C)[C@]3([H])CC[C@@]4([H])C(=C)[C@@H](NC)CC[C@@]45C[C@@]35CC[C@]12C |
| InChI | InChI=1S/C25H42N2O/c1-15-17-7-8-20-23(4)13-19(28)21(16(2)26-5)22(23,3)11-12-25(20)14-24(17,25)10-9-18(15)27-6/h16-21,26-28H,1,7-14H2,2-6H3/t16-,17-,18-,19+,20-,21-,22+,23-,24+,25-/m0/s1 |
| InChIKey | BSNZFQANPMIOIU-WZBMPAQFSA-N |
| Roles Classification |
|---|
| Biological Role: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Cyclobuxine D (CHEBI:3999) is a steroid alkaloid (CHEBI:26767) |
| Synonyms | Source |
|---|---|
| Cyclobuxine | KEGG COMPOUND |
| Cyclobuxine D | KEGG COMPOUND |