EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C5H8O5 |
| Net Charge | 0 |
| Average Mass | 148.114 |
| Monoisotopic Mass | 148.03717 |
| SMILES | O=C(O)CC(O)CC(=O)O |
| InChI | InChI=1S/C5H8O5/c6-3(1-4(7)8)2-5(9)10/h3,6H,1-2H2,(H,7,8)(H,9,10) |
| InChIKey | ZQHYXNSQOIDNTL-UHFFFAOYSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Homo sapiens (ncbitaxon:9606) | |||
| cerebrospinal fluid (UBERON:0001359) | PubMed (10604139) | ||
| blood (UBERON:0000178) | PubMed (16055049) | ||
| blood plasma (BTO_0000131) | PubMed (30218917) | ||
| urine (BTO:0001419) | PubMed (30218917) |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| Biological Roles: | human blood serum metabolite Any metabolite (endogenous or exogenous) found in human blood serum samples. human urinary metabolite Any metabolite (endogenous or exogenous) found in human urine samples. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 3-hydroxyglutaric acid (CHEBI:39980) has functional parent glutaric acid (CHEBI:17859) |
| 3-hydroxyglutaric acid (CHEBI:39980) has role human blood serum metabolite (CHEBI:85234) |
| 3-hydroxyglutaric acid (CHEBI:39980) has role human urinary metabolite (CHEBI:84087) |
| 3-hydroxyglutaric acid (CHEBI:39980) is a 3-hydroxy carboxylic acid (CHEBI:61355) |
| 3-hydroxyglutaric acid (CHEBI:39980) is a α,ω-dicarboxylic acid (CHEBI:28383) |
| 3-hydroxyglutaric acid (CHEBI:39980) is conjugate acid of 3-hydroxyglutarate(2−) (CHEBI:191379) |
| Incoming Relation(s) |
| 3-hydroxyglutarate(2−) (CHEBI:191379) is conjugate base of 3-hydroxyglutaric acid (CHEBI:39980) |
| IUPAC Name |
|---|
| 3-hydroxypentanedioic acid |
| Synonyms | Source |
|---|---|
| 3-hydroxy-glutaric acid | HMDB |
| β-hydroxyglutaric acid | ChEBI |
| Citations |
|---|