EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C7H6O4 |
| Net Charge | 0 |
| Average Mass | 154.121 |
| Monoisotopic Mass | 154.02661 |
| SMILES | O=C(O)c1cc(O)cc(O)c1 |
| InChI | InChI=1S/C7H6O4/c8-5-1-4(7(10)11)2-6(9)3-5/h1-3,8-9H,(H,10,11) |
| InChIKey | UYEMGAFJOZZIFP-UHFFFAOYSA-N |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| Biological Role: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 3,5-dihydroxybenzoic acid (CHEBI:39912) has functional parent benzoic acid (CHEBI:30746) |
| 3,5-dihydroxybenzoic acid (CHEBI:39912) has role metabolite (CHEBI:25212) |
| 3,5-dihydroxybenzoic acid (CHEBI:39912) is a dihydroxybenzoic acid (CHEBI:23778) |
| 3,5-dihydroxybenzoic acid (CHEBI:39912) is a resorcinols (CHEBI:33572) |
| IUPAC Name |
|---|
| 3,5-dihydroxybenzoic acid |
| Synonym | Source |
|---|---|
| α-Resorcylic acid | ChemIDplus |
| Manual Xrefs | Databases |
|---|---|
| HMDB0013677 | HMDB |
| 3,5-Dihydroxybenzoic_acid | Wikipedia |
| CPD0-1274 | MetaCyc |
| Registry Numbers | Sources |
|---|---|
| Reaxys:2207864 | Reaxys |
| CAS:99-10-5 | ChemIDplus |
| Citations |
|---|