EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C17H24O3 |
| Net Charge | 0 |
| Average Mass | 276.376 |
| Monoisotopic Mass | 276.17254 |
| SMILES | CC1CC(OC(=O)C(O)c2ccccc2)CC(C)(C)C1 |
| InChI | InChI=1S/C17H24O3/c1-12-9-14(11-17(2,3)10-12)20-16(19)15(18)13-7-5-4-6-8-13/h4-8,12,14-15,18H,9-11H2,1-3H3 |
| InChIKey | WZHCOOQXZCIUNC-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Application: | vasodilator agent A drug used to cause dilation of the blood vessels. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| cyclandelate (CHEBI:3988) has functional parent 3,3,5-trimethylcyclohexanol (CHEBI:59065) |
| cyclandelate (CHEBI:3988) has functional parent mandelic acid (CHEBI:35825) |
| cyclandelate (CHEBI:3988) has role vasodilator agent (CHEBI:35620) |
| cyclandelate (CHEBI:3988) is a carboxylic ester (CHEBI:33308) |
| cyclandelate (CHEBI:3988) is a secondary alcohol (CHEBI:35681) |
| IUPAC Name |
|---|
| 3,3,5-trimethylcyclohexyl hydroxy(phenyl)acetate |
| INNs | Source |
|---|---|
| cyclandelate | ChemIDplus |
| cyclandelatum | ChemIDplus |
| ciclandelato | ChemIDplus |
| Synonyms | Source |
|---|---|
| 3,3,5-trimethylcyclohexyl mandelate | ChemIDplus |
| 3,5,5-trimethylcyclohexyl amygdalate | DrugBank |