EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C17H18N2O4 |
| Net Charge | 0 |
| Average Mass | 314.341 |
| Monoisotopic Mass | 314.12666 |
| SMILES | N[C@@H](Cc1cc(/N=C/Cc2ccccc2)c(O)cc1O)C(=O)O |
| InChI | InChI=1S/C17H18N2O4/c18-13(17(22)23)8-12-9-14(16(21)10-15(12)20)19-7-6-11-4-2-1-3-5-11/h1-5,7,9-10,13,20-21H,6,8,18H2,(H,22,23)/b19-7+/t13-/m0/s1 |
| InChIKey | BSKROLLIUIDPDT-KUJOXMSCSA-N |
| Roles Classification |
|---|
| Chemical Roles: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| Biological Role: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 2-hydroxy-5-[(1E)-(2-phenylethylidene)amino]-L-tyrosine (CHEBI:39866) has functional parent 2-phenylethylamine (CHEBI:18397) |
| 2-hydroxy-5-[(1E)-(2-phenylethylidene)amino]-L-tyrosine (CHEBI:39866) has role metabolite (CHEBI:25212) |
| 2-hydroxy-5-[(1E)-(2-phenylethylidene)amino]-L-tyrosine (CHEBI:39866) is a L-tyrosine derivative (CHEBI:27177) |
| 2-hydroxy-5-[(1E)-(2-phenylethylidene)amino]-L-tyrosine (CHEBI:39866) is a imine (CHEBI:24783) |
| 2-hydroxy-5-[(1E)-(2-phenylethylidene)amino]-L-tyrosine (CHEBI:39866) is a non-proteinogenic L-α-amino acid (CHEBI:83822) |
| IUPAC Name |
|---|
| 2-hydroxy-5-[(E)-(2-phenylethylidene)amino]-L-tyrosine |
| Manual Xrefs | Databases |
|---|---|
| 2TY | PDBeChem |
| Citations |
|---|